N,O-dimethyl-N'-nitroisourea manufacturers
|
| | N,O-dimethyl-N'-nitroisourea Basic information |
| Product Name: | N,O-dimethyl-N'-nitroisourea | | Synonyms: | N,O-dimethyl-N'-nitroisourea;O-METHYL-N-NITRO-N'-METHYLISOUREA;intermediate for Dinotefuran;N-nitrooxymethylisourea;Carbamimidic acid, N-methyl-N'-nitro-, methyl ester;N-methyl-N'-nitro-Carbamimidic acid methyl ester;N, O-Dimethyl-N′ -Nitrosourea;Carbamimidic acid, N-methyl-N'- | | CAS: | 255708-80-6 | | MF: | C3H7N3O3 | | MW: | 133.11 | | EINECS: | | | Product Categories: | | | Mol File: | 255708-80-6.mol |  |
| | N,O-dimethyl-N'-nitroisourea Chemical Properties |
| Boiling point | 189.8±23.0 °C(Predicted) | | density | 1.32±0.1 g/cm3(Predicted) | | pka | 2.47±0.50(Predicted) | | InChI | InChI=1S/C3H7N3O3/c1-4-3(9-2)5-6(7)8/h1-2H3,(H,4,5) | | InChIKey | ZWHCDLXHQMBZRD-UHFFFAOYSA-N | | SMILES | C(=N[N+]([O-])=O)(OC)NC |
| | N,O-dimethyl-N'-nitroisourea Usage And Synthesis |
| Uses | N,O-dimethyl-N'-nitroisoureais the key intermediate of preparation MTI-446. |
| | N,O-dimethyl-N'-nitroisourea Preparation Products And Raw materials |
|