|
| 2-CHLORO-N,N-DIETHYLANILINE Basic information |
Product Name: | 2-CHLORO-N,N-DIETHYLANILINE | Synonyms: | 2-CHLORO-N,N-DIETHYLANILINE;Chlorodiethylaniline;2-CHLORO-N N-DIETHYLANILINE 98+%;N,N-Diethyl-2-chloroaniline;N,N-Diethyl-o-chloroaniline;o-Chloro-N,N-diethylaniline;2-chloro-N,N-diethylbenzenamine;2-Chloro-N,N-diethylaniline | CAS: | 19372-80-6 | MF: | C10H14ClN | MW: | 183.68 | EINECS: | | Product Categories: | | Mol File: | 19372-80-6.mol | |
| 2-CHLORO-N,N-DIETHYLANILINE Chemical Properties |
Boiling point | 221 °C | density | 1,05 g/cm3 | refractive index | 1.5310-1.5330 | storage temp. | 2-8°C | form | clear liquid | pka | 5.97±0.38(Predicted) | color | Colorless to Light yellow | InChI | InChI=1S/C10H14ClN/c1-3-12(4-2)10-8-6-5-7-9(10)11/h5-8H,3-4H2,1-2H3 | InChIKey | OQRCDIPTOADXMP-UHFFFAOYSA-N | SMILES | C1(N(CC)CC)=CC=CC=C1Cl |
| 2-CHLORO-N,N-DIETHYLANILINE Usage And Synthesis |
Synthesis Reference(s) | Journal of the American Chemical Society, 68, p. 895, 1946 DOI: 10.1021/ja01209a058 |
| 2-CHLORO-N,N-DIETHYLANILINE Preparation Products And Raw materials |
|