|
|
| | 5-Acetylthiophene-2-carboxylic acid Basic information |
| Product Name: | 5-Acetylthiophene-2-carboxylic acid | | Synonyms: | AKOS MSC-0226;LABOTEST-BB LT00454683;BUTTPARK 121\06-15;5-Acetylthiophene-2-CarboxylicAcid98%;5-Acetylthiophene-2-Carboxylic Acid 98%;5-Acetyltiophene-2-carboxylic acid;5-Acetylthiophene-2-Carboxylic;5-ACETYL-2-THIOPHENECARBOXYLIC ACID | | CAS: | 4066-41-5 | | MF: | C7H6O3S | | MW: | 170.19 | | EINECS: | 609-857-0 | | Product Categories: | Thiophenes | | Mol File: | 4066-41-5.mol |  |
| | 5-Acetylthiophene-2-carboxylic acid Chemical Properties |
| Melting point | 210-212°C | | Boiling point | 385.2±27.0 °C(Predicted) | | density | 1.383 | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | form | powder to crystal | | pka | 2.95±0.10(Predicted) | | color | White to Yellow | | BRN | 128897 | | InChI | InChI=1S/C7H6O3S/c1-4(8)5-2-3-6(11-5)7(9)10/h2-3H,1H3,(H,9,10) | | InChIKey | LIKIMWYKJUFVJP-UHFFFAOYSA-N | | SMILES | C1(C(O)=O)SC(C(C)=O)=CC=1 | | CAS DataBase Reference | 4066-41-5(CAS DataBase Reference) |
| Provider | Language |
|
ALFA
| English |
| | 5-Acetylthiophene-2-carboxylic acid Usage And Synthesis |
| Description |
5-Acetylthiophene-2-carboxylic acid is a light yellow crystal with good thermal and chemical stability. It can be dissolved in various organic solvents, such as ethanol, ether, and chloroform, making it easy to handle and process in chemical reactions. It can be used as a raw material to synthesize compounds such as 5-Ethylthiophene-2-carboxylic acid.
| | Chemical Properties | cream to pale brown solid | | Uses | 5-Acetylthiophene-2-carboxylic acid is a intermediate used in the preparation of various 2,5-disubstituted thiophenes. | | Synthesis Reference(s) | Journal of Heterocyclic Chemistry, 3, p. 104, 1966 DOI: 10.1002/jhet.5570030127 |
| | 5-Acetylthiophene-2-carboxylic acid Preparation Products And Raw materials |
|