|
| Diethyl 2,5-dihydroxyterephthalate Basic information |
Product Name: | Diethyl 2,5-dihydroxyterephthalate | Synonyms: | DIETHYL 2,5-DIHYDROXYTEREPHTHALATE;1,4-Benzendicarboxylicacid,2,5-dihydroxy-,diethylester;4-benzenedicarboxylicacid,2,5-dihydroxy-diethylester;DIETHYL 2 5-DIHYDROXYTEREPHTHALATE 98%;2,5-Dihydroxyterephthalic acid diethyl ester;2,5-Dihydroxy-1,4-benzenedicarboxylic acid diethyl ester;2,5-dihydroxybenzene-1,4-dicarboxylic acid diethyl ester;diethyl 2,5-dihydroxybenzene-1,4-dicarboxylate | CAS: | 5870-38-2 | MF: | C12H14O6 | MW: | 254.24 | EINECS: | 227-522-3 | Product Categories: | Alcohols;Monomers;Polymer Science | Mol File: | 5870-38-2.mol | |
| Diethyl 2,5-dihydroxyterephthalate Chemical Properties |
Melting point | 135-137 °C(lit.) | Boiling point | 408.5±40.0 °C(Predicted) | density | 1.303±0.06 g/cm3(Predicted) | storage temp. | Inert atmosphere,Room Temperature | pka | 9.59±0.23(Predicted) | InChI | InChI=1S/C12H14O6/c1-3-17-11(15)7-5-10(14)8(6-9(7)13)12(16)18-4-2/h5-6,13-14H,3-4H2,1-2H3 | InChIKey | UQOUOXLHXPHDHF-UHFFFAOYSA-N | SMILES | C1(C(OCC)=O)=CC(O)=C(C(OCC)=O)C=C1O | EPA Substance Registry System | 1,4-Benzenedicarboxylic acid, 2,5-dihydroxy-, diethyl ester (5870-38-2) |
Hazard Codes | Xi | Risk Statements | 36/37/38 | Safety Statements | 26-37/39 | WGK Germany | 3 | HS Code | 29182900 |
| Diethyl 2,5-dihydroxyterephthalate Usage And Synthesis |
| Diethyl 2,5-dihydroxyterephthalate Preparation Products And Raw materials |
|