|
| 3-(1-Piperazinyl)-1,2-benzisothiazole Basic information |
| 3-(1-Piperazinyl)-1,2-benzisothiazole Chemical Properties |
Melting point | 89.0 to 93.0 °C | Boiling point | 320.2±35.0 °C(Predicted) | density | 1.256 | storage temp. | 2-8°C | solubility | soluble in Methanol | form | powder to crystal | pka | 8.52±0.10(Predicted) | color | White to Light yellow | BRN | 4253627 | InChI | InChI=1S/C11H13N3S/c1-2-4-10-9(3-1)11(13-15-10)14-7-5-12-6-8-14/h1-4,12H,5-8H2 | InChIKey | KRDOFMHJLWKXIU-UHFFFAOYSA-N | SMILES | S1C2=C(C=CC=C2)C(N2CCNCC2)=N1 | LogP | 2.14 | CAS DataBase Reference | 87691-87-0(CAS DataBase Reference) |
Hazard Codes | Xi,T | Risk Statements | 25-36/38 | Safety Statements | 26-45 | RIDADR | UN 2811 6.1 / PGIII | WGK Germany | 3 | HazardClass | IRRITANT | HS Code | 29349990 |
| 3-(1-Piperazinyl)-1,2-benzisothiazole Usage And Synthesis |
Chemical Properties | 3-(1-Piperazinyl)-1,2-benzisothiazole is Yellow Solid | Uses | 3-(1-Piperazinyl)-1,2-benzisothiazole is a reagent used to synthesize Ziprasidione | Definition | ChEBI: ID11614 is a N-arylpiperazine. |
| 3-(1-Piperazinyl)-1,2-benzisothiazole Preparation Products And Raw materials |
|