(R)-3-Aminopentanoic acid manufacturers
|
| (R)-3-Aminopentanoic acid Basic information |
| (R)-3-Aminopentanoic acid Chemical Properties |
Boiling point | 230.1±23.0 °C(Predicted) | density | 1.067±0.06 g/cm3(Predicted) | storage temp. | 2-8°C | pka | 3.80±0.10(Predicted) | InChI | InChI=1S/C5H11NO2/c1-2-4(6)3-5(7)8/h4H,2-3,6H2,1H3,(H,7,8)/t4-/m1/s1 | InChIKey | QFRURJKLPJVRQY-SCSAIBSYSA-N | SMILES | C(O)(=O)C[C@H](N)CC |
| (R)-3-Aminopentanoic acid Usage And Synthesis |
Uses | (R)-3-Aminopentanoic acid is an amino acid organic compound used as a pharmaceutical intermediate in the fields of medicine and chemical industry. |
| (R)-3-Aminopentanoic acid Preparation Products And Raw materials |
|