|
|
| | FHD-286 Basic information |
| Product Name: | FHD-286 | | Synonyms: | 1H-Pyrrole-3-carboxamide, N-[(1S)-2-[[4-[6-[(2R,6S)-2,6-dimethyl-4-morpholinyl]-2-pyridinyl]-2-thiazolyl]amino]-1-(methoxymethyl)-2-oxoethyl]-1-(methylsulfonyl)-;FHD-286;Inhibitor,inhibit,FHD 286,FHD-286,Epigenetic Reader Domain,FHD286;N-[(1S)-2-[[4-[6-[cis-2,6-dimethylmorpholin-4-yl]-2-pyridyl]thiazol-2-yl]amino]-1-(methoxymethyl)-2-oxo-ethyl]-1-methylsulfonyl-pyrrole-3-carboxamide;N-[(S)-1-[[4-[6-[(2R,6S)-2,6-Dimethylmorpholino]-2-pyridyl]-2-thiazolyl]amino]-3-methoxy-1-oxo-2-propyl]-1-(methylsulfonyl)-1H-pyrrole-3-carboxamide;N-[(2S)-1-[[4-[6-[(2S,6R)-2,6-dimethyl-4-morpholinyl]-2-pyridinyl]-2-thiazolyl]amino]-3-methoxy-1-oxopropan-2-yl]-1-methylsulfonyl-3-pyrrolecarboxamide | | CAS: | 2671128-05-3 | | MF: | C24H30N6O6S2 | | MW: | 562.66 | | EINECS: | | | Product Categories: | | | Mol File: | 2671128-05-3.mol |  |
| | FHD-286 Chemical Properties |
| density | 1.46±0.1 g/cm3(Predicted) | | storage temp. | Store at -20°C | | solubility | DMSO : 250 mg/mL (444.32 mM; Need ultrasonic) | | form | Solid | | pka | 7.18±0.50(Predicted) | | color | Off-white to light yellow | | InChIKey | JBLQNFBXKOAIHG-FCEWJHQRSA-N | | SMILES | N1(S(C)(=O)=O)C=CC(C(N[C@@H](COC)C(NC2=NC(C3=NC(N4C[C@H](C)O[C@H](C)C4)=CC=C3)=CS2)=O)=O)=C1 |
| | FHD-286 Usage And Synthesis |
| Description |
FHD-286 is a highly potent, selective, allosteric and orally available, small-molecule, enzymatic inhibitor of BRG1 (SMARCA4) and BRM (SMARCA2), two highly similar proteins that are the ATPases, or the catalytic engines of the BAF complex, one of the critical regulators within the chromatin regulatory system. In preclinical studies, FHD-286 has shown anti-tumour activity across a broad range of malignancies, including hematologic and solid tumours. FHD-286 is being developed for relapsed and/or refractory AML.
|
| | FHD-286 Preparation Products And Raw materials |
|