| Company Name: |
Binhai gill polypeptide co. LTD
|
| Tel: |
021-61263389 13524856427 |
| Email: |
Joetang@glschina.com |
| Products Intro: |
CAS:1301700-95-7
Purity:98% Remarks:2g
|
| Company Name: |
Pushan Industry (Shaanxi) Co., Ltd.
|
| Tel: |
029-81310890 13571859809 |
| Email: |
info@pushanshiye.com |
| Products Intro: |
Product Name:5,8,11-Trioxa-2-azatridecanoic acid, 12,12-dimethyl-10-oxo-, 1,1-dimethylethyl ester
CAS:1301700-95-7
Purity:98
|
| Company Name: |
https://www.shachemlin.cn/
|
| Tel: |
15021879576 |
| Email: |
ming-jiao.wu@chemlin.com.cn |
| Products Intro: |
Product Name:N-BOC-2-(2-(2-Aminoethoxy)ethoxy)acetic acid tert-butyl ester
CAS:1301700-95-7
Purity:98% Package:10g;100g;500g
|
5,8,11-Trioxa-2-azatridecanoic acid, 12,12-dimethyl-10-oxo-, 1,1-dimethylethyl ester manufacturers
|
| | 5,8,11-Trioxa-2-azatridecanoic acid, 12,12-dimethyl-10-oxo-, 1,1-dimethylethyl ester Basic information |
| Product Name: | 5,8,11-Trioxa-2-azatridecanoic acid, 12,12-dimethyl-10-oxo-, 1,1-dimethylethyl ester | | Synonyms: | 5,8,11-Trioxa-2-azatridecanoic acid, 12,12-dimethyl-10-oxo-, 1,1-dimethylethyl ester;N-BOC-2-(2-(2-Aminoethoxy)ethoxy)acetic acid tert-butyl ester;Boc-AEEA-tBu | | CAS: | 1301700-95-7 | | MF: | C15H29NO6 | | MW: | 319.39 | | EINECS: | | | Product Categories: | | | Mol File: | 1301700-95-7.mol |  |
| | 5,8,11-Trioxa-2-azatridecanoic acid, 12,12-dimethyl-10-oxo-, 1,1-dimethylethyl ester Chemical Properties |
| Boiling point | 410.7±30.0 °C(Predicted) | | density | 1.048±0.06 g/cm3(Predicted) | | pka | 12.22±0.46(Predicted) | | color | Colorless to yellow liquid | | InChI | InChI=1S/C15H29NO6/c1-14(2,3)21-12(17)11-20-10-9-19-8-7-16-13(18)22-15(4,5)6/h7-11H2,1-6H3,(H,16,18) | | InChIKey | GQOVSJVFIDMTHY-UHFFFAOYSA-N | | SMILES | C(OC(C)(C)C)(=O)NCCOCCOCC(=O)OC(C)(C)C |
| | 5,8,11-Trioxa-2-azatridecanoic acid, 12,12-dimethyl-10-oxo-, 1,1-dimethylethyl ester Usage And Synthesis |
| | 5,8,11-Trioxa-2-azatridecanoic acid, 12,12-dimethyl-10-oxo-, 1,1-dimethylethyl ester Preparation Products And Raw materials |
|