| Company Name: |
SuZhou ShiYa Biopharmaceuticals, Inc.
|
| Tel: |
0512-52358471 17715136450 |
| Email: |
sales@shiyabiopharm.com |
| Products Intro: |
Product Name:1-(2-Chloro-6-fluoro-3-nitro-phenyl)-ethanone
CAS:2384249-14-1
Purity:95% Remarks:B1-9139
|
| Company Name: |
Zhuo Ruining (Shanghai) Technology Co., Ltd
|
| Tel: |
0086-18163338995; 18163338995 |
| Email: |
2605578685@qq.com |
| Products Intro: |
Product Name:1-(2-chloro-6-fluoro-3-nitrophenyl)ethanone
CAS:2384249-14-1
Purity:97%+ Package:g，kg
|
| Company Name: |
Hubei Benofu Chemical Technology Co., Ltd.
|
| Tel: |
15307183689 |
| Email: |
393985636@qq.com |
| Products Intro: |
Product Name:1-(2-chloro-6-fluoro-3-nitrophenyl)ethanone
CAS:2384249-14-1
Purity:98% Package:5g;25g;100g
|
|
| | 1-(2-chloro-6-fluoro-3-nitrophenyl)ethanone Basic information |
| | 1-(2-chloro-6-fluoro-3-nitrophenyl)ethanone Chemical Properties |
| Boiling point | 245.7±35.0 °C(Predicted) | | density | 1.460±0.06 g/cm3(Predicted) | | InChI | InChI=1S/C8H5ClFNO3/c1-4(12)7-5(10)2-3-6(8(7)9)11(13)14/h2-3H,1H3 | | InChIKey | WHOVAHSEXABIJX-UHFFFAOYSA-N | | SMILES | C(=O)(C1=C(F)C=CC([N+]([O-])=O)=C1Cl)C |
| | 1-(2-chloro-6-fluoro-3-nitrophenyl)ethanone Usage And Synthesis |
| | 1-(2-chloro-6-fluoro-3-nitrophenyl)ethanone Preparation Products And Raw materials |
|