- DMT-dG(dmf)-CE
-
- $0.00 / 100mg
-
2024-08-08
- CAS:330628-04-1
- Min. Order: 100mg
- Purity: ≥99%
- Supply Ability: 20tons
- dG(dmf) CE Phosphoramidite
-
- $100.00 / 15kg
-
2023-03-22
- CAS:330628-04-1
- Min. Order: 0.009999999776482582kg
- Purity: 99%
- Supply Ability: 5tons
|
| | DMT-dG(dmf) Phosphoramidite Basic information |
| Product Name: | DMT-dG(dmf) Phosphoramidite | | Synonyms: | N4-(DIMETHYLAMINO)METHYLENE)-5'-O-(DIMETHOXYTRITYL)-2'-DEOXYGUANOSINE-3'-N,N-DIISOPROPYL (CYANOETHYL) PHOSPHORAMIDITE;DMT-dG(dmf) amidite;N2-(dimethylamino)methylene-deoxyguanosine Phosphoramidite;(2R,3S,5R)-2-((bis(4-methoxyphenyl)(phenyl)methoxy)methyl)-5-(2-((E)-(dimethylamino)methyleneamino)-6-oxo-1H-purin-9(6H)-yl)tetrahydrofuran-3-yl 2-cyanoethyl diisopropylphosphoramidite;REF DUPL: DMF-dG-CE-Phophoramidite;N4-(Dimethylamino) methylene)-5'-O-(dimethoxytrityl)-2'-deoxyguanosine-3'-N,N-diisopropyl(cyanoethyl) phosphoramidite;2'-Deoxy-N2-DMF-5'-O-DMT-guanosine 3'-CE phosphoramidite;N2-Dimethylformamidine-5′-O-(4,4′-dimethoxytrityl)-2′-deoxyguanosine-3′-O-[O-(2-cyanoethyl)-N,N′-diisopropylphosphoramidite] | | CAS: | 330628-04-1 | | MF: | C43H53N8O7P | | MW: | 824.9 | | EINECS: | 2017-001-1 | | Product Categories: | DNA Amidites;Fast Deprotection DNA Amidites;Sigma-Proligo;Pharmaceutical;RNAi;Amidite | | Mol File: | 330628-04-1.mol |  |
| | DMT-dG(dmf) Phosphoramidite Chemical Properties |
| Boiling point | 876.3±75.0 °C(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C | | solubility | DMSO : 100 mg/mL (121.23 mM; Need ultrasonic) | | pka | 3.80±0.20(Predicted) | | form | powder | | color | white to off-white | | InChIKey | YRQAXTCBMPFGAN-UNHDIWNRSA-N | | SMILES | C12N=C(/N=C/N(C)C)NC(=O)C=1N=CN2[C@H]1C[C@@H]([C@@H](COC(C2C=CC=CC=2)(C2C=CC(OC)=CC=2)C2=CC=C(C=C2)OC)O1)OP(OCCC#N)N(C(C)C)C(C)C |&1:15,17,18,r| |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 29349990 |
| | DMT-dG(dmf) Phosphoramidite Usage And Synthesis |
| Chemical Properties | White or off-white power | | Uses | Dmf-dG-CE phosphoramidite is a nucleotide and guanosine (G837895) derivative used in the preparation of synthetic RNA fragments, and other macromolecules such as micellar thrombin-binding aptamers as anticoagulants. | | Definition | 5'-O-DMT-2'-Deoxyguanosine(DMF)-CE Phosphoramidite, or DMT-dG(dmf) Phosphoramidite, is a nucleoside amidite analog comprised of 2'-deoxy-N2,5'-O-dimethoxytrityl guanosine (DMF) and 5'-O-dimethoxytrityl cytidine monophosphate (DMT).
|
| | DMT-dG(dmf) Phosphoramidite Preparation Products And Raw materials |
|