|
|
| | 2-bromothiazol-4-amine Basic information |
| Product Name: | 2-bromothiazol-4-amine | | Synonyms: | 2-broMo-1,3-thiazol-4-aMine;4-ThiazolaMine, 2-broMo-;2-BroMothiazol-4-aMine(HBr forM);2-bromothiazol-4-amine;4-Amino-2-bromothiazole;2-bromo-4-thiazolamine;2-bromothiazol-4-amine，95%;Meloxicam Impurity 28 | | CAS: | 41731-33-3 | | MF: | C3H3BrN2S | | MW: | 179.04 | | EINECS: | 1533716-785-6 | | Product Categories: | | | Mol File: | 41731-33-3.mol |  |
| | 2-bromothiazol-4-amine Chemical Properties |
| Boiling point | 278.5±13.0 °C(Predicted) | | density | 1.976±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | 1.56±0.10(Predicted) | | InChI | InChI=1S/C3H3BrN2S/c4-3-6-2(5)1-7-3/h1H,5H2 | | InChIKey | CFVNVCUJPRPMCN-UHFFFAOYSA-N | | SMILES | S1C=C(N)N=C1Br |
| | 2-bromothiazol-4-amine Usage And Synthesis |
| Uses | 2-Bromo-4-thiazolamine is used in preparation of electron deficient-type and electron deficient conjugated extended Isoindigo compounds. |
| | 2-bromothiazol-4-amine Preparation Products And Raw materials |
|