|
| Potassium hydrogen 2-oxoglutarate Basic information |
Product Name: | Potassium hydrogen 2-oxoglutarate | Synonyms: | 2-KETOGLUTARIC ACID POTASSIUM SALT;alpha-ketoglutaric acid potassium salt;potassium hydrogen 2-oxoglutarate;A-KETOGLUTARIC ACID MONOPOTASSIUM;2-Ketoglutaric Acid Monopotassium;A-KetoglutaricAcidMonopotassiumSalt;á-Ketoglutaric acid monopotassium salt;Potasium hydrogen 2-ketoglutarate | CAS: | 997-43-3 | MF: | C5H5KO5 | MW: | 184.19 | EINECS: | 213-641-8 | Product Categories: | | Mol File: | 997-43-3.mol | ![Potassium hydrogen 2-oxoglutarate Structure](CAS/GIF/997-43-3.gif) |
| Potassium hydrogen 2-oxoglutarate Chemical Properties |
density | 1.74 g/cm3 | storage temp. | 2-8°C | InChI | InChI=1S/C5H6O5.K/c6-3(5(9)10)1-2-4(7)8;/h1-2H2,(H,7,8)(H,9,10);/q;+1/p-1 | InChIKey | XTCZBVVKDHLWKU-UHFFFAOYSA-M | SMILES | [K+].C(O)(=O)C(=O)CCC([O-])=O | CAS DataBase Reference | 997-43-3(CAS DataBase Reference) |
| Potassium hydrogen 2-oxoglutarate Usage And Synthesis |
Uses | 2-Ketoglutaric Acid Monopotassium Salt can be used as antithrombin for coating organs during transplantation. |
| Potassium hydrogen 2-oxoglutarate Preparation Products And Raw materials |
|