|
|
| | 2,3,4-Trifluorobenzoic acid Basic information |
| Product Name: | 2,3,4-Trifluorobenzoic acid | | Synonyms: | 2,3,4-trifluorobenzoic acid and derivatives;2,3,4-TRIFLUOROBENZOIC ACID THE DERIVATIVES;2,3,4-Trifluorobenzoic;2,3,4-Trifluorobenzoic acid 98%;2,3,4-Trifluorobenzoicacid98%;2,3,4-Trifluorobenzoic acid and the derivatives;2,3,4-Trifluorobenzoic Acid, 97+%;2 and 4 - three acid | | CAS: | 61079-72-9 | | MF: | C7H3F3O2 | | MW: | 176.09 | | EINECS: | 612-077-3 | | Product Categories: | FINE Chemical & INTERMEDIATES;C7;Carbonyl Compounds;Carboxylic Acids;Aromatic Carboxylic Acids, Amides, Anilides, Anhydrides & Salts;Benzoic acid;Miscellaneous;Fluorobenzoic acids;Fluorin-contained Benzoic acid series;bc0001;61079-72-9 | | Mol File: | 61079-72-9.mol |  |
| | 2,3,4-Trifluorobenzoic acid Chemical Properties |
| Melting point | 140-142 °C (lit.) | | Boiling point | 245.3±35.0 °C(Predicted) | | density | 1,404g/cm | | refractive index | 1,482 | | storage temp. | 2-8°C | | solubility | DMSO, Methanol | | form | Solid | | pka | 2.87±0.10(Predicted) | | color | White | | BRN | 7476020 | | InChI | InChI=1S/C7H3F3O2/c8-4-2-1-3(7(11)12)5(9)6(4)10/h1-2H,(H,11,12) | | InChIKey | WEPXLRANFJEOFZ-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=C(F)C(F)=C1F | | CAS DataBase Reference | 61079-72-9(CAS DataBase Reference) | | NIST Chemistry Reference | 2,3,4-Trifluorobenzoic acid(61079-72-9) | | EPA Substance Registry System | Benzoic acid, 2,3,4-trifluoro- (61079-72-9) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39-36 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29163990 |
| | 2,3,4-Trifluorobenzoic acid Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powder | | Uses | 2,3,4-Trifluorobenzoic Acid is used in the preparation of benzamide derivatives with potential anti-cancer properties. It is also used in the preparation of polyfluoroaryl oxazoline compounds. | | General Description | Raman and FTIR spectra for 2,3,4-tri-fluoro-benzoic acid has been studied. |
| | 2,3,4-Trifluorobenzoic acid Preparation Products And Raw materials |
|