4-Amino-2,5-difluorobenzotrifluoride manufacturers
|
| 4-Amino-2,5-difluorobenzotrifluoride Basic information |
Product Name: | 4-Amino-2,5-difluorobenzotrifluoride | Synonyms: | 4-AMINO-2,5-DIFLUOROBENZOTRIFLUORIDE;2,5-DIFLUORO-4-(TRIFLUOROMETHYL)ANILINE;4-AMINO-2,5-DIFLUOROBENZOTRIFLUORIDE 97+%;2,5-Difluoro-4-(trifluoromethyl)aniline, 97+%;Benzenamine, 2,5-difluoro-4-(trifluoromethyl)-;2,5-Difluoro-4-(trifluoromethyl)benzenamine | CAS: | 114973-22-7 | MF: | C7H4F5N | MW: | 197.11 | EINECS: | | Product Categories: | | Mol File: | 114973-22-7.mol | ![4-Amino-2,5-difluorobenzotrifluoride Structure](CAS/GIF/114973-22-7.gif) |
| 4-Amino-2,5-difluorobenzotrifluoride Chemical Properties |
Boiling point | 196°C | density | 1,512 g/cm3 | storage temp. | 2-8°C | pka | 0.35±0.10(Predicted) | form | liquid | color | Light Yellow | InChI | InChI=1S/C7H4F5N/c8-4-2-6(13)5(9)1-3(4)7(10,11)12/h1-2H,13H2 | InChIKey | FPEXXFHBKBTGJL-UHFFFAOYSA-N | SMILES | C1(N)=CC(F)=C(C(F)(F)F)C=C1F | CAS DataBase Reference | 114973-22-7(CAS DataBase Reference) |
Hazard Codes | Xi | Risk Statements | 23/24/25 | Safety Statements | 26-36/37/39-45 | RIDADR | 2810 | Hazard Note | Irritant | HazardClass | 6.1 | HS Code | 2921490090 |
Provider | Language |
ALFA
| English |
| 4-Amino-2,5-difluorobenzotrifluoride Usage And Synthesis |
| 4-Amino-2,5-difluorobenzotrifluoride Preparation Products And Raw materials |
|