- Thionicotinamide
-
- $10.00 / 1Kg/Bag
-
2021-10-21
- CAS:4621-66-3
- Min. Order: 1Kg/Bag
- Purity: 99%
- Supply Ability: 20 Tons
- THIONICOTINAMIDE
-
- $10.00 / 1PCS
-
2021-03-13
- CAS:4621-66-3
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 10 mt
- THIONICOTINAMIDE
-
- $8.00 / 1kg
-
2019-07-06
- CAS:4621-66-3
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 10tons
|
| | Thionicotinamide Basic information |
| Product Name: | Thionicotinamide | | Synonyms: | 3-PYRIDYLTHIOCARBOXAMIDE;Pyridine-3-thiocarboxamide;Thionicotinamide,98%;PYRIDINE-3-THIOCARBOXAMIDE (THIONICOTINAMIDE);Nicotinthioamide;Thionicotinamide,99%;pyridin-3-ylthioamide;THIONICOTINAMIDE | | CAS: | 4621-66-3 | | MF: | C6H6N2S | | MW: | 138.19 | | EINECS: | 225-036-6 | | Product Categories: | | | Mol File: | 4621-66-3.mol |  |
| | Thionicotinamide Chemical Properties |
| Melting point | 185-190 °C | | Boiling point | 278.9±32.0 °C(Predicted) | | density | 1.235 (estimate) | | refractive index | 1.5300 (estimate) | | Fp | 160 °C | | storage temp. | Inert atmosphere,Room Temperature | | pka | 12.01±0.29(Predicted) | | form | Powder | | color | Yellow to yellow-green | | BRN | 109593 | | InChI | InChI=1S/C6H6N2S/c7-6(9)5-2-1-3-8-4-5/h1-4H,(H2,7,9) | | InChIKey | XQWBMZWDJAZPPX-UHFFFAOYSA-N | | SMILES | C1=NC=CC=C1C(N)=S | | LogP | 0.670 | | CAS DataBase Reference | 4621-66-3(CAS DataBase Reference) | | EPA Substance Registry System | 3-Pyridinecarbothioamide (4621-66-3) |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 24/25-36-26 | | RTECS | QS4488000 | | TSCA | Yes | | HazardClass | IRRITANT | | HS Code | 29333990 |
| | Thionicotinamide Usage And Synthesis |
| Chemical Properties | yellow powder | | Definition | Thionicotinamide is the active moiety of two previously identified NADK inhibitors, NADS and NADPS. Treatment of C85 cancer cells with thionicotinamide resulted in an identical loss of dihydrofolate reductase levels, a G1/S block, and similar toxicity profiles as NADS and NADPS; that is, thionicotinamide is a prodrug and is converted intracellularly to NADPS[1].
| | References | [1] Philip M Tedeschi. “Suppression of Cytosolic NADPH Pool by Thionicotinamide Increases Oxidative Stress and Synergizes with Chemotherapy.” Molecular Pharmacology 88 4 (2015): 720–7.
|
| | Thionicotinamide Preparation Products And Raw materials |
|