Methyl 2-Acetyl-3-(3-nitrophenyl)-5-oxo-hexanoate manufacturers
|
| | Methyl 2-Acetyl-3-(3-nitrophenyl)-5-oxo-hexanoate Basic information |
| Product Name: | Methyl 2-Acetyl-3-(3-nitrophenyl)-5-oxo-hexanoate | | Synonyms: | Methyl 2-Acetyl-3-(3-nitrophenyl)-5-oxo-hexanoate;Nicardipine Impurity86;Nicardipine Impurity 13;bis(2-(benzyl(methyl)amino)ethyl) 2,4-diacetyl-3-(3-nitrophenyl)pentanedioate;Benzenepropanoic acid, α-acetyl-3-nitro-β-(2-oxopropyl)-, methyl ester;Nicardipine Impurity 16;Nicardipine Impurity A5;5-((2-(benzyl(methyl)amino)ethoxy)carbonyl)-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylic acid sodium | | CAS: | 2469555-30-2 | | MF: | C15H17NO6 | | MW: | 307.29858 | | EINECS: | | | Product Categories: | | | Mol File: | 2469555-30-2.mol |  |
| | Methyl 2-Acetyl-3-(3-nitrophenyl)-5-oxo-hexanoate Chemical Properties |
| Melting point | 89 - 92°C | | Boiling point | 452.0±45.0 °C(Predicted) | | density | 1.236±0.06 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 10.56±0.59(Predicted) | | color | White to Off-White | | InChI | InChI=1S/C15H17NO6/c1-9(17)7-13(14(10(2)18)15(19)22-3)11-5-4-6-12(8-11)16(20)21/h4-6,8,13-14H,7H2,1-3H3 | | InChIKey | RAJXBQGICRMTEL-UHFFFAOYSA-N | | SMILES | C(OC)(=O)C(C(C)=O)C(C1=CC=CC([N+]([O-])=O)=C1)CC(=O)C |
| | Methyl 2-Acetyl-3-(3-nitrophenyl)-5-oxo-hexanoate Usage And Synthesis |
| Uses | Methyl 2-Acetyl-3-(3-nitrophenyl)-5-oxo-hexanoate is a useful synthetic intermediate. |
| | Methyl 2-Acetyl-3-(3-nitrophenyl)-5-oxo-hexanoate Preparation Products And Raw materials |
|