|
|
| | Bis(4-aminophenoxy)ethane Basic information |
| Product Name: | Bis(4-aminophenoxy)ethane | | Synonyms: | 1,2-Bis(p-aminophenoxy)ethane;Bis(4-aminophenoxy)ethane;4,4''-ETHANEDIYLDIOXYDIANILINE ,98%;4,4''-[ETHANE-1,2-DIYLBIS(OXY)]DIANILINE;Benzenamine, 4,4'-[1,2-ethanediylbis(oxy)]bis-;4-[2-(4-aminophenoxy)ethoxy]aniline;4,4'-(Ethane-1,2-diylbis(oxy))dianiline;EPPN2 | | CAS: | 6052-10-4 | | MF: | C14H16N2O2 | | MW: | 244.29 | | EINECS: | | | Product Categories: | | | Mol File: | 6052-10-4.mol |  |
| | Bis(4-aminophenoxy)ethane Chemical Properties |
| Melting point | 179 °C(Solv: ethanol (64-17-5)) | | Boiling point | 477.2±30.0 °C(Predicted) | | density | 1.204±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 5.40±0.10(Predicted) | | InChI | InChI=1S/C14H16N2O2/c15-11-1-5-13(6-2-11)17-9-10-18-14-7-3-12(16)4-8-14/h1-8H,9-10,15-16H2 | | InChIKey | HHDFKOSSEXYTJN-UHFFFAOYSA-N | | SMILES | C(OC1=CC=C(N)C=C1)COC1=CC=C(N)C=C1 |
| | Bis(4-aminophenoxy)ethane Usage And Synthesis |
| Uses | Bis(4-aminophenoxy)ethane can be used in the synthesis of dyes, especially in the manufacture of special pigments and coatings. |
| | Bis(4-aminophenoxy)ethane Preparation Products And Raw materials |
|