Methyl 2-heptyl-4,6-dihydroxybenzoate manufacturers
|
| | Methyl 2-heptyl-4,6-dihydroxybenzoate Basic information |
| Product Name: | Methyl 2-heptyl-4,6-dihydroxybenzoate | | Synonyms: | Benzoic acid, 2-heptyl-4,6-dihydroxy-, methyl ester;2-heptyl-4,6-dihydroxyBenzoic acid methyl ester;methyl 2,4-dihydroxy-6-heptylbenzoate;methyl 2-heptyl-4,6-dihydroxybenzoate | | CAS: | 6121-77-3 | | MF: | C15H22O4 | | MW: | 266.33 | | EINECS: | 000-000-0 | | Product Categories: | | | Mol File: | 6121-77-3.mol |  |
| | Methyl 2-heptyl-4,6-dihydroxybenzoate Chemical Properties |
| Boiling point | 431.8±30.0 °C(Predicted) | | density | 1.111±0.06 g/cm3(Predicted) | | pka | 8.28±0.23(Predicted) | | InChI | InChI=1S/C15H22O4/c1-3-4-5-6-7-8-11-9-12(16)10-13(17)14(11)15(18)19-2/h9-10,16-17H,3-8H2,1-2H3 | | InChIKey | UXZJWFSSCUTTBN-UHFFFAOYSA-N | | SMILES | C(OC)(=O)C1=C(O)C=C(O)C=C1CCCCCCC |
| | Methyl 2-heptyl-4,6-dihydroxybenzoate Usage And Synthesis |
| Chemical Properties | Off white to faint pink solid. | | Uses | In cosmetics (lotions, creams, and other cosmetics), methyl 2-heptyl-4,6-dihydroxybenzoate can be used as a preservative, an antioxidant and to enhance the scent and texture of products. In pharmaceuticals, it is used as a flavoring agent and as an anti-inflammatory. Methyl 2-heptyl-4,6-dihydroxybenzoate is also used in the fragrance industry, as a fixative and to add depth and complexity to scents. It is also used as a stabilizer in food products, where it helps to prevent oxidation and rancidity. | | Safety | Methyl 2-heptyl-4,6-dihydroxybenzoate is considered to be a safe and non-toxic compound. |
| | Methyl 2-heptyl-4,6-dihydroxybenzoate Preparation Products And Raw materials |
|