|
| 2-(4-BROMOPHENYL)-1,1-DIPHENYLETHYLENE Basic information |
Product Name: | 2-(4-BROMOPHENYL)-1,1-DIPHENYLETHYLENE | Synonyms: | 2-(4-BROMOPHENYL)-1,1-DIPHENYLETHYLENE;2-(4-BROMOPHENYL)-1,1-DIPHENYLETHYLENE,98.0+%(GC);1,1-Diphenyl-2-(4-bromophenyl)ethene;2-(4-Bromophenyl)-1,1-diphenylethene;1-(2-(4-Bromophenyl)-1-phenylvinyl)benzene ,98%;(2-(4-bromophenyl)ethene-1,1-diyl)dibenzene;1-Bromo-4-(2,2-diphenylvinyl)benzene;2-(p-Bromophenyl)-1,1-diphenyl-ethylene | CAS: | 18648-66-3 | MF: | C20H15Br | MW: | 335.24 | EINECS: | | Product Categories: | OLED materials | Mol File: | 18648-66-3.mol |  |
| 2-(4-BROMOPHENYL)-1,1-DIPHENYLETHYLENE Chemical Properties |
Melting point | 79 °C | Boiling point | 404.4±14.0 °C(Predicted) | density | 1.313±0.06 g/cm3(Predicted) | storage temp. | Sealed in dry,Room Temperature | solubility | soluble in Toluene | form | powder to crystal | color | White to Almost white | InChI | InChI=1S/C20H15Br/c21-19-13-11-16(12-14-19)15-20(17-7-3-1-4-8-17)18-9-5-2-6-10-18/h1-15H | InChIKey | HUCFDUOIMSRYAA-UHFFFAOYSA-N | SMILES | C1(Br)=CC=C(/C=C(/C2=CC=CC=C2)\C2=CC=CC=C2)C=C1 |
| 2-(4-BROMOPHENYL)-1,1-DIPHENYLETHYLENE Usage And Synthesis |
| 2-(4-BROMOPHENYL)-1,1-DIPHENYLETHYLENE Preparation Products And Raw materials |
|