- 1,2-Dianilinoethane
-
- $0.00 / 1KG
-
2024-07-15
- CAS:150-61-8
- Min. Order: 1KG
- Purity: 99.0%
- Supply Ability: 1000KG
- 1,2-DIANILINOETHANE
-
- $1.00 / 1KG
-
2020-03-06
- CAS:150-61-8
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 200kgs
|
| | 1,2-Dianilinoethane Basic information |
| Product Name: | 1,2-Dianilinoethane | | Synonyms: | n,n’-diphenyl-ethylenediamin;N,N'-Difenylethylendiamin;N,N'-Diphenyl-1,2-ethylenediamine;N,N'-Diphenyl-alpha,omega-diaminoethane;NODX;Stabilite;sym-Diphenylethylenediamine;N,N-Diphenylethylenediamine~Wanzlicks | | CAS: | 150-61-8 | | MF: | C14H16N2 | | MW: | 212.29 | | EINECS: | 205-765-6 | | Product Categories: | | | Mol File: | 150-61-8.mol |  |
| | 1,2-Dianilinoethane Chemical Properties |
| Melting point | 65-67 °C(lit.) | | Boiling point | 228°C 12mm | | density | 1.0799 (rough estimate) | | refractive index | 1.6000 (estimate) | | Fp | 228°C/12mm | | pka | 4.67±0.50(Predicted) | | form | powder to crystal | | color | White to Light yellow to Light red | | Water Solubility | Sparingly soluble in water 0.072 g/L @ 25°C. | | Merck | 14,2990 | | BRN | 646740 | | InChI | InChI=1S/C14H16N2/c1-3-7-13(8-4-1)15-11-12-16-14-9-5-2-6-10-14/h1-10,15-16H,11-12H2 | | InChIKey | NOUUUQMKVOUUNR-UHFFFAOYSA-N | | SMILES | C(NC1=CC=CC=C1)CNC1=CC=CC=C1 | | CAS DataBase Reference | 150-61-8(CAS DataBase Reference) | | EPA Substance Registry System | N,N'-Diphenylethylenediamine (150-61-8) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | RTECS | KV4800000 | | F | 34 | | TSCA | Yes | | HS Code | 29214200 |
| | 1,2-Dianilinoethane Usage And Synthesis |
| Chemical Properties | BEIGE TO LIGHT BROWN CRYSTALLINE POWDER | | Uses | 1,2-Dianilinoethane can forms crystalline imidazolidines with aldehydes in the presence of AcOH. N-donating ligand. Can be used as a trapping agent for aldehydes. | | Application | N,N′-Diphenylethylenediamine can be used:
To prepare nickel(II) chelates to study their chemical reactivities.
To prepare N-heterocyclic carbene (NHC) adducts by reacting with substituted benzaldehydes.
As a starting material to prepare substituted cyclic poly(methyl methacrylate)s. | | Synthesis Reference(s) | Synthetic Communications, 22, p. 1081, 1992 DOI: 10.1080/00397919208019300 | | Purification Methods | Crystallise the reagent from aqueous EtOH or MeOH. [Beilstein 12 H 543, 12 IV 986.] |
| | 1,2-Dianilinoethane Preparation Products And Raw materials |
|