| Company Name: |
Jiangsu Aikon Biopharmaceutical R&D co.,Ltd.
|
| Tel: |
025-66099280 17798518460 |
| Email: |
cfzhang@aikonchem.com |
| Products Intro: |
Product Name:2-Fluoro-3-(trifluoroMethoxy)benzoic acid
CAS:1159512-62-5
Purity:95% Package:1g;5g;10g
|
| Company Name: |
9ding chemical ( Shanghai) Limited
|
| Tel: |
4009209199 |
| Email: |
sales@9dingchem.com |
| Products Intro: |
Product Name:2-Fluoro-3-(trifluoromethoxy)benzoic acid
CAS:1159512-62-5
Purity:98%
|
|
| | 2-Fluoro-3-(trifluoromethoxy)benzoic acid Basic information |
| | 2-Fluoro-3-(trifluoromethoxy)benzoic acid Chemical Properties |
| Boiling point | 246.7±35.0 °C(Predicted) | | density | 1.529±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 2.89±0.10(Predicted) | | form | crystalline needles | | color | White | | InChI | InChI=1S/C8H4F4O3/c9-6-4(7(13)14)2-1-3-5(6)15-8(10,11)12/h1-3H,(H,13,14) | | InChIKey | VUFVRYWIHCPNGN-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=CC(OC(F)(F)F)=C1F |
| | 2-Fluoro-3-(trifluoromethoxy)benzoic acid Usage And Synthesis |
| | 2-Fluoro-3-(trifluoromethoxy)benzoic acid Preparation Products And Raw materials |
|