(Z)-2-cyanoethyl 2-(4-cyano-2-methoxybenzylidene)-3-oxobutanoate manufacturers
|
| | (Z)-2-cyanoethyl 2-(4-cyano-2-methoxybenzylidene)-3-oxobutanoate Basic information |
| Product Name: | (Z)-2-cyanoethyl 2-(4-cyano-2-methoxybenzylidene)-3-oxobutanoate | | Synonyms: | (Z)-2-cyanoethyl 2-(4-cyano-2-methoxybenzylidene)-3-oxobutanoate;2-Cyanoethyl 2- (4-cyano-2- Methoxy group benzylidene) -3-oxobutyrate;Butanoic acid, 2-[(4-cyano-2-methoxyphenyl)methylene]-3-oxo-, 2-cyanoethyl ester;2-cyanoethyl (2E)-2-[(4-cyano-2-methoxyphenyl)methylidene]-3-oxobutanoate;(Z)-2-cyaethyl 2-(4-cya-2-methoxybenzylidene)-3-oxobutaate;Finerenone Impurity 50(Mixture of Z and E Isomers);Finerenone Impurity 92 | | CAS: | 1050477-39-8 | | MF: | C16H14N2O4 | | MW: | 298.29 | | EINECS: | | | Product Categories: | Intermediate | | Mol File: | 1050477-39-8.mol |  |
| | (Z)-2-cyanoethyl 2-(4-cyano-2-methoxybenzylidene)-3-oxobutanoate Chemical Properties |
| Boiling point | 525.2±50.0 °C(Predicted) | | density | 1.24±0.1 g/cm3(Predicted) | | InChI | InChI=1S/C16H14N2O4/c1-11(19)14(16(20)22-7-3-6-17)9-13-5-4-12(10-18)8-15(13)21-2/h4-5,8-9H,3,7H2,1-2H3 | | InChIKey | RFJLQSVKIAMLCX-UHFFFAOYSA-N | | SMILES | C(OCCC#N)(=O)C(=CC1=CC=C(C#N)C=C1OC)C(=O)C |
| | (Z)-2-cyanoethyl 2-(4-cyano-2-methoxybenzylidene)-3-oxobutanoate Usage And Synthesis |
| Uses | Intermediate for Finerenone. |
| | (Z)-2-cyanoethyl 2-(4-cyano-2-methoxybenzylidene)-3-oxobutanoate Preparation Products And Raw materials |
|