|
| Niraparib tosylate Basic information |
Product Name: | Niraparib tosylate | Synonyms: | MK-4827, Niraparib TsOH salt hydrate;Niraparib tosylate monohyrate;(S)-2-(4-(piperidin-3-yl)phenyl)-2H-indazole-7-carboxamide 4-methylbenzenesulfonate hydrate;Niraparib TsOH salt hydrate;Nilapani toluene monohydrate;Niraparib TOS H2O;Niraparib tosylate hydrate;Niraparib Tosylate Monohydrate (API) | CAS: | 1613220-15-7 | MF: | C26H28N4O4S | MW: | 492.59 | EINECS: | | Product Categories: | API;1613220-15-7 | Mol File: | 1613220-15-7.mol | ![Niraparib tosylate Structure](CAS/20180906/GIF/1613220-15-7.gif) |
| Niraparib tosylate Chemical Properties |
form | Solid | color | White to off-white | InChIKey | LCPFHXWLJMNKNC-XOIICWPPNA-N | SMILES | S(C1C=CC(C)=CC=1)(O)(=O)=O.C(C1=CC=CC2=CN(C3C=CC([C@H]4CNCCC4)=CC=3)N=C12)(=O)N |&1:23,r| |
| Niraparib tosylate Usage And Synthesis |
Uses | Niraparib tosylate hydrate is a sulfonic acid organic compound that can be used as a pharmaceutical intermediate. |
| Niraparib tosylate Preparation Products And Raw materials |
|