| Company Name: |
Labnetwork lnc. |
| Tel: |
+86-27-50766799 +8618062016861 |
| Email: |
contact@labnetwork.com |
| Products Intro: |
Product Name:1-(9H-fluoren-9-yl)-3-oxo-2,7,10,13,16,19,22,25,28,31,34,37,40-tridecaoxa-4-azatritetracontan-43-oic acid
CAS:1952360-91-6
Purity:95% Package:100g; 1kg Remarks:LN03239880
|
|
|
|
|
FmocNH-PEG12-CH2CH2COOH manufacturers
|
| | FmocNH-PEG12-CH2CH2COOH Basic information |
| Product Name: | FmocNH-PEG12-CH2CH2COOH | | Synonyms: | Fmoc-nh-peg(16)-cooh;(Fmoc-amino)-PEG12-C2-Carboxylic Acid;Fmoc-nh-peg12-C2-cooh;1-(9H-Fluoren-9-yl)-3-oxo-2,7,10,13,16,19,22,25,28,31,34,37,40-tridecaoxa-4-azatritetracontan-43-oic Acid;Carboxy-PEG12-(Fmoc-amine);5,8,11,14,17,20,23,26,29,32,35,38-Dodecaoxa-2-azahentetracontanedioic acid, 1-(9H-fluoren-9-ylmethyl) ester;Inhibitor,Fmoc-NH-PEG-12-CH2CH2COOH,inhibit,Fmoc NH PEG12 CH2CH2COOH,PROTAC Linkers,FmocNHPEG12CH2CH2COOH;FmocNH-PEG12-CH2CH2COOH/5,8,11,14,17,20,23,26,29,32,35,38-Dodecaoxa-2-azahentetracontanedioic acid, 1-(9H-fluoren-9-ylmethyl) ester | | CAS: | 1952360-91-6 | | MF: | C42H65NO16 | | MW: | 839.96 | | EINECS: | | | Product Categories: | Fmoc | | Mol File: | 1952360-91-6.mol |  |
| | FmocNH-PEG12-CH2CH2COOH Chemical Properties |
| Boiling point | 870.4±65.0 °C(Predicted) | | density | 1.175±0.06 g/cm3(Predicted) | | pka | 4.28±0.10(Predicted) | | form | clear liquid | | color | Colorless to Light yellow | | InChIKey | JYNHRDJTWNEGJE-UHFFFAOYSA-N | | SMILES | C(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)(=O)NCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCC(O)=O |
| | FmocNH-PEG12-CH2CH2COOH Usage And Synthesis |
| Description | Fmoc-N-amido-PEG12-acid is a PEG linker containing an Fmoc-protected amine and a terminal carboxylic acid. The hydrophilic PEG spacer increases solubility in aqueous media. The Fmoc group can be deprotected under basic condition to obtain the free amine which can be used for further conjugations. The terminal carboxylic acid can react with primary amine groups in the presence of activators (e.g. EDC, or HATU) to form a stable amide bond. | | General Description |
FmocNH-PEG12-CH2CH2COOH is a PEG-based PROTAC linker. Fmoc-NH-PEG12-CH2CH2COOH can be used in the synthesis of PROTAC.
| | storage | Keep in dark place,Inert atmosphere,Store in freezer, under -20 ℃. |
| | FmocNH-PEG12-CH2CH2COOH Preparation Products And Raw materials |
|