|
|
| | 4-bromo-2-methoxybenzaldehyde Basic information |
| Product Name: | 4-bromo-2-methoxybenzaldehyde | | Synonyms: | 2-Methoxy-4-broMobenzaldehyde;5-Bromo-2-formylanisole, 4-Bromo-o-anisaldehyde;4-BroMo-2-Methoxybenzaldehyde, 97%+;4-Bromo-2-methoxybenzaldehyde 98%;Benzaldehyde, 4-bromo-2-methoxy-;4-BROMO-2-METHOXYBENZALDEHYDE | | CAS: | 43192-33-2 | | MF: | C8H7BrO2 | | MW: | 215.04 | | EINECS: | | | Product Categories: | Intermediate | | Mol File: | 43192-33-2.mol |  |
| | 4-bromo-2-methoxybenzaldehyde Chemical Properties |
| Melting point | 67-71 °C | | Boiling point | 52-54 °C(Press: 0.04 Torr) | | density | 1.522±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | Water Solubility | Soluble in water. | | Sensitive | Air Sensitive | | InChI | InChI=1S/C8H7BrO2/c1-11-8-4-7(9)3-2-6(8)5-10/h2-5H,1H3 | | InChIKey | YMXQYZABFWVXEK-UHFFFAOYSA-N | | SMILES | C(=O)C1=CC=C(Br)C=C1OC |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 24/25 | | WGK Germany | 2 | | HS Code | 29130000 |
| | 4-bromo-2-methoxybenzaldehyde Usage And Synthesis |
| Chemical Properties | off-white solid | | Uses |
4-Bromo-2-methoxybenzaldehyde is used in the building block, synthesis of a nonacid degradable linker for solid-phase synthesis. It is a useful intermediate in the chemical industry.
| | Synthesis | A synthesis of 4-bromo-2-methoxybenzaldehyde is reported from 1,4 dibromo 2-fluorobenzene. First, 2-fluoro-4-bromobenzaldehyde is prepared through metal halogen exchange and formylation with a formyl source at 0° C. After crystallization, this intermediate is reacted with methanol in the presence of potassium carbonate. Subsequently, 4-bromo-2-methoxy-benzaldehyde is crystallized.
|
| | 4-bromo-2-methoxybenzaldehyde Preparation Products And Raw materials |
|