| Company Name: |
Shanghai AmasPharm Co., Ltd.
|
| Tel: |
021-54540637 18621091017 |
| Email: |
sales@amaspharm.com |
| Products Intro: |
Product Name:1-(3,5-Bis(trifluoromethyl)phenyl)-2,2,2-trifluoroethanone
CAS:130336-17-3
Package:25g;50g;100g
|
| Company Name: |
MQ (shanghai) Pharmaceuticals Co., Ltd.
|
| Tel: |
13761635123 |
| Email: |
1014988033@qq.com |
| Products Intro: |
Product Name:1-(3,5-Bis(triuoromethyl)phenyl)-2,2, 2-triuoroethanone
CAS:130336-17-3
Purity:＞95% Package:1G,5G
|
|
| | 1-(3,5-Bis(trifluoromethyl)phenyl)-2,2,2-trifluoroethanone Basic information |
| Product Name: | 1-(3,5-Bis(trifluoromethyl)phenyl)-2,2,2-trifluoroethanone | | Synonyms: | 1-(3,5-Bis(tri?uoromethyl)phenyl)-2,2, 2-tri?uoroethanone;1-(3,5-Bis(trifluoromethyl)phenyl)-2,2,2-trifluoroethanone;Ethanone, 1-[3,5-bis(trifluoromethyl)phenyl]-2,2,2-trifluoro- | | CAS: | 130336-17-3 | | MF: | C10H3F9O | | MW: | 310.12 | | EINECS: | | | Product Categories: | | | Mol File: | 130336-17-3.mol |  |
| | 1-(3,5-Bis(trifluoromethyl)phenyl)-2,2,2-trifluoroethanone Chemical Properties |
| Boiling point | 154.1±35.0 °C(Predicted) | | density | 1.517±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | InChI | InChI=1S/C10H3F9O/c11-8(12,13)5-1-4(7(20)10(17,18)19)2-6(3-5)9(14,15)16/h1-3H | | InChIKey | AMSJGWJKJSLIEU-UHFFFAOYSA-N | | SMILES | C(=O)(C1=CC(C(F)(F)F)=CC(C(F)(F)F)=C1)C(F)(F)F |
| | 1-(3,5-Bis(trifluoromethyl)phenyl)-2,2,2-trifluoroethanone Usage And Synthesis |
| Uses | 1-(3,5-bis(trifluoromethyl)phenyl)-2,2,2-trifluoroethanone is a polyfluorinated compound. It is an important compound that can be used as a pharmaceutical intermediate in drug synthesis and scientific research.
|
| | 1-(3,5-Bis(trifluoromethyl)phenyl)-2,2,2-trifluoroethanone Preparation Products And Raw materials |
|