|
|
| | 2,4-Difluorobenzonitrile Basic information |
| Product Name: | 2,4-Difluorobenzonitrile | | Synonyms: | 2,4-DIFLUOROBENZONITRILE;2，4-difluorobenzotrile;2,4-Difluorobenzonitrile,98%;2,4-difluorobenzonilyile;2,4-Difluorobenzonitrile 98%;2,4-Difluorobenzenecarbonitrile;2,4-DIFLUOROBENZONITRILE 97+%;CASNO: 3939-9-1 | | CAS: | 3939-09-1 | | MF: | C7H3F2N | | MW: | 139.1 | | EINECS: | 223-523-8 | | Product Categories: | Aromatic Nitriles;Nitrile;Boron, Nitrile, Thio,& TM-Cpds;Fluorobenzene Series;Fluorine Compounds;Nitriles;C6 to C7;Cyanides/Nitriles;Nitrogen Compounds;OLED | | Mol File: | 3939-09-1.mol |  |
| | 2,4-Difluorobenzonitrile Chemical Properties |
| Melting point | 47-49 °C (lit.) | | Boiling point | 189°C | | density | 1.246 | | Fp | >230 °F | | storage temp. | Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | form | Crystalline | | color | White to Almost white | | BRN | 1940316 | | InChI | InChI=1S/C7H3F2N/c8-6-2-1-5(4-10)7(9)3-6/h1-3H | | InChIKey | LJFDXXUKKMEQKE-UHFFFAOYSA-N | | SMILES | C(#N)C1=CC=C(F)C=C1F | | CAS DataBase Reference | 3939-09-1(CAS DataBase Reference) |
| | 2,4-Difluorobenzonitrile Usage And Synthesis |
| Chemical Properties | white crystalline solid | | Uses | 2,4-Difluorobenzonitrile has been used in the synthesis of:
- 2-methylsulfonyl-4-fluorobenzylamine
- fluoro-3-amino-1,2-benzisoxazoles
| | General Description | 2,4-Difluorobenzonitrile undergoes polycondensation with Bisphenol A and matrix-assisted laser desorption/time-of-flight mass spectra revealed a quantitative formation of cyclic oligoethers and polyethers. |
| | 2,4-Difluorobenzonitrile Preparation Products And Raw materials |
|