2-BROMO-10-THIAXANTHENONE manufacturers
|
| | 2-BROMO-10-THIAXANTHENONE Basic information |
| Product Name: | 2-BROMO-10-THIAXANTHENONE | | Synonyms: | 2-BROMO-10-THIAXANTHENONE;2-bromothioxanthen-9-one;TIANFU-CHEM - 2-BROMO-10-THIAXANTHENONE;2-Bromo-10H-dibenzo[b,e]thiopyran-10-one;9H-Thioxanthen-9-one, 2-bromo-;2-Bromothioxanthone;2-bromo-9H-thioxanthen-9-one;7-bromo-3,4-dihydro-9H-thioxanthen-9-one | | CAS: | 20077-10-5 | | MF: | C13H7BrOS | | MW: | 291.16 | | EINECS: | | | Product Categories: | | | Mol File: | 20077-10-5.mol |  |
| | 2-BROMO-10-THIAXANTHENONE Chemical Properties |
| Melting point | 233-234 °C(Solv: acetic acid (64-19-7)) | | Boiling point | 422.0±44.0 °C(Predicted) | | density | 1.633±0.06 g/cm3(Predicted) | | InChI | InChI=1S/C13H7BrOS/c14-8-5-6-12-10(7-8)13(15)9-3-1-2-4-11(9)16-12/h1-7H | | InChIKey | XOYDXFFMXDJBQU-UHFFFAOYSA-N | | SMILES | C1(=O)C2=C(C=CC=C2)SC2=C1C=C(Br)C=C2 |
| | 2-BROMO-10-THIAXANTHENONE Usage And Synthesis |
| | 2-BROMO-10-THIAXANTHENONE Preparation Products And Raw materials |
|