|
|
| | 1,3-Bis(3-methacryloxypropyl)tetramethyldisiloxane Basic information |
| Product Name: | 1,3-Bis(3-methacryloxypropyl)tetramethyldisiloxane | | Synonyms: | TSL 9706;2-propenoicacid,2-methyl-,(1,1,3,3-tetramethyl-1,3-disiloxanediyl)di-3,1-pro;1,3-BIS(3-METHACRYLOXYPROPYL)TETRAMETHYLDISILOXANE;1,3-BIS(3-METHACRYLOYLOXYPROPYL)-1,1,3,3-TETRAMETHYLDISILOXANE;3,3'-(1,1,3,3-TETRAMETHYLDISILOXAN-1,3-DIYL)DIPROPYL DIMETHACRYLATE;METHACRYLOXYPROPYL TERMINATED POLYDIMETHYLSILOXANE;METHACRYLOXYPROPYL TERMINATED POLYDIMETHYLSILOXANES;BIS(3-METHACRYLOXYPROPYL) TETRAMETHYLDISILOXANE | | CAS: | 18547-93-8 | | MF: | C18H34O5Si2 | | MW: | 386.63 | | EINECS: | 242-419-3 | | Product Categories: | Industrial/Fine Chemicals;monomer | | Mol File: | 18547-93-8.mol |  |
| | 1,3-Bis(3-methacryloxypropyl)tetramethyldisiloxane Chemical Properties |
| Melting point | <0°C | | Boiling point | 127°C 3mm | | density | 0.966 g/mL at 20 °C(lit.) | | vapor pressure | 0.005Pa at 25℃ | | refractive index | n20/D 1.45 | | Fp | >110°C | | storage temp. | below 5° C | | Specific Gravity | 0.96 | | Water Solubility | 1.5μg/L at 20℃ | | Hydrolytic Sensitivity | 3: reacts with aqueous base | | InChI | InChI=1S/C18H34O5Si2/c1-15(2)17(19)21-11-9-13-24(5,6)23-25(7,8)14-10-12-22-18(20)16(3)4/h1,3,9-14H2,2,4-8H3 | | InChIKey | ZIFLDVXQTMSDJE-UHFFFAOYSA-N | | SMILES | [Si](CCCOC(=O)C(C)=C)(C)(C)O[Si](CCCOC(=O)C(C)=C)(C)C | | LogP | 8.1 at 20℃ | | CAS DataBase Reference | 18547-93-8(CAS DataBase Reference) | | EPA Substance Registry System | 1,3-Bis(3-methacryloyloxypropyl)tetramethyldisiloxane (18547-93-8) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | TSCA | Yes |
| | 1,3-Bis(3-methacryloxypropyl)tetramethyldisiloxane Usage And Synthesis |
| Flammability and Explosibility | Not classified | | Synthesis | Cool down 600g H2O to below 5°C, slowly add the intermediate product 3-(chlorodimethylsilyl)propyl methacrylate, restore room temperature and stir for 8h. Then stand, separate the organic phase, wash with water to neutral, add anhydrous sodium sulfate to dry the organic phase, filter to remove the desiccant, and remove the low boiling point substance in the system under reduced pressure to obtain 645.11g of product 1,3-Bis(3-methacryloxypropyl)tetramethyldisiloxane, with a yield of 97%.
 |
| | 1,3-Bis(3-methacryloxypropyl)tetramethyldisiloxane Preparation Products And Raw materials |
|