tetramisole manufacturers
- Tetramisole
-
- $1.00 / 2kg
-
2024-07-13
- CAS:5036-02-2
- Min. Order: 10kg
- Purity: 99%
- Supply Ability: 1000
- tetramisole
-
- $70.00 / 1KG
-
2021-08-10
- CAS:5036-02-2
- Min. Order: 2KG
- Purity: 99%
- Supply Ability: ＞1000kg
|
| | tetramisole Basic information |
| Product Name: | tetramisole | | Synonyms: | (+-)-2,3,5,6-tetrahydro-6-phenylimidazo(2,1-b)thiazole;DL-tetramisole;Imidazo2,1-bthiazole, 2,3,5,6-tetrahydro-6-phenyl-;Tetramizole;6-phenyl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole;6-phenyl-2,3,5,6-tetrahydroimidazo[2,1-b]thiazole | | CAS: | 5036-02-2 | | MF: | C11H12N2S | | MW: | 204.29 | | EINECS: | 225-729-3 | | Product Categories: | | | Mol File: | 5036-02-2.mol |  |
| | tetramisole Chemical Properties |
| Melting point | 87-89° | | Boiling point | 344.4±45.0 °C(Predicted) | | density | 1.32±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO; Methanol | | form | Solid | | pka | 10.00±0.40(Predicted) | | color | White (powder) | | InChI | InChI=1S/C11H12N2S/c1-2-4-9(5-3-1)10-8-13-6-7-14-11(13)12-10/h1-5,10H,6-8H2 | | InChIKey | HLFSDGLLUJUHTE-UHFFFAOYSA-N | | SMILES | S1CCN2CC(C3=CC=CC=C3)N=C12 | | EPA Substance Registry System | Tetramisole (5036-02-2) |
| | tetramisole Usage And Synthesis |
| Uses | Tetramisol is an isolated intermediate in the synthesis of 4-Hydroxy-tetramisole (H595270), a metabolite of Tetramisole, an anthelmintic. | | Definition | ChEBI: 6-phenyl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole is an imidazothiazole that is imidazo[2,1-b][1,3]thiazole in which the double bonds at the 2-3 and 5-6 positions have been reduced to single bonds and in which one of the hydrogens at position 6 is replaced by a phenyl group. It has a role as a xenobiotic and an environmental contaminant. |
| | tetramisole Preparation Products And Raw materials |
|