- METHYL ISONICOTINATE
-
- $2.00 / 1KG
-
2019-07-06
- CAS:29800-89-3
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: customise
|
| METHYL ISONICOTINATE Basic information |
Product Name: | METHYL ISONICOTINATE | Synonyms: | PYRIDINE-4-YL-ACETIC ACID METHYL ESTER;RARECHEM AL BF 0097;4-Picolinicacidmethylester;Methyl4-PyridineCarBonate;Methyl 4-Pyridinylacetate;4-Pyridineacetic acid methyl ester;4-Pyridinylacetic acid methyl ester;2-(4-pyridyl)acetic acid methyl ester | CAS: | 29800-89-3 | MF: | C8H9NO2 | MW: | 151.16 | EINECS: | 249-856-9 | Product Categories: | Acids and Derivatives;Heterocycles | Mol File: | 29800-89-3.mol | ![METHYL ISONICOTINATE Structure](CAS/GIF/29800-89-3.gif) |
| METHYL ISONICOTINATE Chemical Properties |
Melting point | 8-8.5 °C(lit.) | Boiling point | 207-209 °C(lit.) | density | 1.161 g/mL at 25 °C(lit.) | refractive index | n20/D 1.512(lit.) | Fp | 180 °F | storage temp. | Inert atmosphere,2-8°C | pka | 5.27±0.10(Predicted) | form | liquid | color | Orange | InChI | InChI=1S/C8H9NO2/c1-11-8(10)6-7-2-4-9-5-3-7/h2-5H,6H2,1H3 | InChIKey | ZOKQLMMQYVXILS-UHFFFAOYSA-N | SMILES | C1=NC=CC(CC(OC)=O)=C1 | CAS DataBase Reference | 29800-89-3(CAS DataBase Reference) |
Hazard Codes | Xi | Risk Statements | 36/37/38 | Safety Statements | 26-36 | WGK Germany | 3 | F | 10 | HS Code | 2933399990 |
| METHYL ISONICOTINATE Usage And Synthesis |
| METHYL ISONICOTINATE Preparation Products And Raw materials |
|