|
|
| | Methyl 2-(chloromethyl)thiazole-4-carboxylate Basic information |
| Product Name: | Methyl 2-(chloromethyl)thiazole-4-carboxylate | | Synonyms: | 4-Thiazolecarboxylicacid,2-(chloromethyl)-,methylester(9CI);Methyl 2-(chloromethyl)thiazole-4-carboxylate;4-Thiazolecarboxylicacid,2-(chloromethyl)-,methylester(9CI) ISO 9001：2015 REACH;4-Thiazolecarboxylic acid, 2-(chloromethyl)-, methyl ester;Methyl 2-(chloromethyl)thiazole-4-carboxylate 97%;2-(chloromethyl)-4-thiazolecarboxylic acid methyl ester;2-Chloromethylthiazol-4-carboxylic acid methyl ester | | CAS: | 321371-29-3 | | MF: | C6H6ClNO2S | | MW: | 191.64 | | EINECS: | | | Product Categories: | THIAZOLE | | Mol File: | 321371-29-3.mol |  |
| | Methyl 2-(chloromethyl)thiazole-4-carboxylate Chemical Properties |
| Boiling point | 261.2±20.0 °C(Predicted) | | density | 1.391±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | -0.48±0.10(Predicted) | | InChI | InChI=1S/C6H6ClNO2S/c1-10-6(9)4-3-11-5(2-7)8-4/h3H,2H2,1H3 | | InChIKey | SRDRWIMXEFYHIK-UHFFFAOYSA-N | | SMILES | S1C=C(C(OC)=O)N=C1CCl |
| | Methyl 2-(chloromethyl)thiazole-4-carboxylate Usage And Synthesis |
| Uses | Methyl 2-(chloromethyl)thiazole-4-carboxylate is mainly used in organic synthesis reactions and is also a pharmaceutical intermediate ingredient used in the preparation of lysophosphatidic acid receptor antagonists or other inhibitors. | | storage | Inert atmosphere, 2-8℃. |
| | Methyl 2-(chloromethyl)thiazole-4-carboxylate Preparation Products And Raw materials |
|