|
|
| | 3'-fluoro-3'-deoxyadenosine Basic information |
| Product Name: | 3'-fluoro-3'-deoxyadenosine | | Synonyms: | 3'-fluoro-3'-deoxyadenosine;(2R,3S,4S,5R)-2-(6-Amino-9H-purin-9-yl)-4-fluoro-5-(hydroxymethyl)tetrahydrofuran-3-ol;3'-F-3'-rA;Adenosine, 3'-deoxy-3'-fluoro-;3'-fluoro-3'-deoxyadenosine;3’-Deoxy-3’-fluoro adenosine | | CAS: | 75059-22-2 | | MF: | C10H12FN5O3 | | MW: | 269.23 | | EINECS: | | | Product Categories: | | | Mol File: | 75059-22-2.mol |  |
| | 3'-fluoro-3'-deoxyadenosine Chemical Properties |
| Melting point | 211-212 °C | | Boiling point | 628.6±65.0 °C(Predicted) | | density | 2.01±0.1 g/cm3(Predicted) | | pka | 12.45±0.70(Predicted) | | InChI | InChI=1S/C10H12FN5O3/c11-5-4(1-17)19-10(7(5)18)16-3-15-6-8(12)13-2-14-9(6)16/h2-5,7,10,17-18H,1H2,(H2,12,13,14)/t4-,5-,7-,10-/m1/s1 | | InChIKey | QCDAWXDDXYQEJJ-QYYRPYCUSA-N | | SMILES | OC[C@H]1O[C@@H](N2C3C(=C(N=CN=3)N)N=C2)[C@H](O)[C@@H]1F |
| | 3'-fluoro-3'-deoxyadenosine Usage And Synthesis |
| Uses | 3'-deoxy-3'-fluoroadenosine can be used as pharmaceutical intermediates for pharmaceutical experimental research. | | Biological Activity | 3'-Fluoro-3'-deoxyadenosine was active against a broad range of viruses, encompassing both DNA viruses [pox (vaccinia)], single-stranded (+) RNA viruses [picorna (polio, Coxsackie B), toga (sindbis, Semliki Forest)] and double-stranded RNA viruses (reo). Its antiviral activity spectrum, 3'-fluoro-3'-deoxyadenosine, clearly differed from those adenosine analogs known as inhibitors of S-adenosylhomocysteine hydrolase. 3'-Fluoro-3'-deoxyadenosine also proved effective in vivo in inhibiting tail lesion formation in mice inoculated intravenously with vaccinia virus[1]. | | References | [1] A. Van Aerschot. “Synthesis and antiviral activity evaluation of 3′-fluoro-3′-deoxyribonucleosides: broad-spectrum antiviral activity of 3′-fluoro-3′-deoxyadenosine.” Antiviral research 12 3 (1989): Pages 133-150. |
| | 3'-fluoro-3'-deoxyadenosine Preparation Products And Raw materials |
|