|
| 4'-Aminobenzo-18-crown-6 Basic information |
Product Name: | 4'-Aminobenzo-18-crown-6 | Synonyms: | 4'-AMINOBENZO-18-CROWN-6;4-AMINOBENZO-18-CROWN-6 SESQUIHYDRATE HYDROCHLORIDE;2,3,5,6,8,9,11,12,14,15-DECAHYDRO-1,4,7,10,13,16-BENZOHEXAOXACYCLOOCTADECIN-18-AMINE;2,3,5,6,8,9,11,12,14,15-DECAHYDRO-1,4,7,10,13,16-BENZOHEXAOXXACYCLO-OCTADECIN-18-AMINE HYDROCHLORIDE;(BENZO-18-CROWN-6)-4'-YLAMINE;4-AMINOBENZO-18-CROWN-6 PURUM,97%;2,3,5,6,8,9,11,12,14,15-decahydrobenzo[b][1,4,7,10,13,16]hexaoxacyclooctadecin-18-aMine;4'-AMinobenzo-18-crown-6 technical | CAS: | 68941-06-0 | MF: | C16H25NO6 | MW: | 327.37 | EINECS: | | Product Categories: | | Mol File: | 68941-06-0.mol | ![4'-Aminobenzo-18-crown-6 Structure](CAS/GIF/68941-06-0.gif) |
| 4'-Aminobenzo-18-crown-6 Chemical Properties |
Melting point | 53-56 °C | Boiling point | 511.9±50.0 °C(Predicted) | density | 1.099±0.06 g/cm3(Predicted) | storage temp. | 0-6°C | pka | 4.62±0.20(Predicted) | BRN | 5296463 | InChI | InChI=1S/C16H25NO6/c17-14-1-2-15-16(13-14)23-12-10-21-8-6-19-4-3-18-5-7-20-9-11-22-15/h1-2,13H,3-12,17H2 | InChIKey | PZXYILUXRGTFGD-UHFFFAOYSA-N | SMILES | O1C2=CC=C(N)C=C2OCCOCCOCCOCCOCC1 |
| 4'-Aminobenzo-18-crown-6 Usage And Synthesis |
Description |
4′-Aminophenyl-18-crown-6 is a cyclic compound. It is widely used as an ion carrier. It coordinates to metal ions more easily than other ligands because its planar oxygen atoms provide a strong negative potential barrier. 4'-aminobenzo-18-Crown-6 (AB18C6) could be used to design and fabricate a novel magnetic absorbent for absorption and determination of lead metal ion (Pb2+) based on a self-assembly approach via the dehydration condensation[1].
| References |
[1] yan Jing-Kang et al. “4′-Aminobenzo-18-crown-6 functionalized magnetic nanoparticles as a solid-phase extraction adsorbent for the determination of Pb2+?.” Analytical Methods 13 (2019): 1735–1742.
|
| 4'-Aminobenzo-18-crown-6 Preparation Products And Raw materials |
|