|
| 1-Methyl-5-nitro-1H-benzimidazole-2-butanoic Acid Ethyl Ester Basic information |
| 1-Methyl-5-nitro-1H-benzimidazole-2-butanoic Acid Ethyl Ester Chemical Properties |
Melting point | 100-104°C | Boiling point | 481.0±25.0 °C(Predicted) | density | 1.30±0.1 g/cm3(Predicted) | storage temp. | 2-8°C | solubility | Dichloromethane, Ethyl Acetate, Methanol | form | Solid | pka | 3.78±0.10(Predicted) | color | Brown | InChI | InChI=1S/C14H17N3O4/c1-3-21-14(18)6-4-5-13-15-11-9-10(17(19)20)7-8-12(11)16(13)2/h7-9H,3-6H2,1-2H3 | InChIKey | VJVBGSJZBDBEIF-UHFFFAOYSA-N | SMILES | C1(CCCC(OCC)=O)N(C)C2=CC=C([N+]([O-])=O)C=C2N=1 |
| 1-Methyl-5-nitro-1H-benzimidazole-2-butanoic Acid Ethyl Ester Usage And Synthesis |
Chemical Properties | Light Brown Solid | Uses | Labelled Bendamustine | Uses | 1-Methyl-5-nitro-1H-benzimidazole-2-butanoic Acid Ethyl Ester is a Bendamustine intermediate. |
| 1-Methyl-5-nitro-1H-benzimidazole-2-butanoic Acid Ethyl Ester Preparation Products And Raw materials |
|