|
|
| | 5,7-difluorochroman-4-one Basic information |
| Product Name: | 5,7-difluorochroman-4-one | | Synonyms: | 4H-1-Benzopyran-4-one, 5,7-difluoro-2,3-dihydro-;5,7-Difluoro-2,3-dihydro-4H-chromen-4-one;5,7-Difluoro-3,4-dihydro-4H-chromen-4-one;5,7-difluorochroman-4-one;5,7-DIFLUORO-2,3-DIHYDRO-1-BENZOPYRAN-4-ONE;5,7-difluoro-3,4-dihydro-2H-1-benzopyran-4-one;Tegoprazan Impurity 10 | | CAS: | 844648-22-2 | | MF: | C9H6F2O2 | | MW: | 184.14 | | EINECS: | | | Product Categories: | | | Mol File: | 844648-22-2.mol |  |
| | 5,7-difluorochroman-4-one Chemical Properties |
| Boiling point | 283℃ | | density | 1.392 | | Fp | 121℃ | | storage temp. | Sealed in dry,Room Temperature | | InChI | InChI=1S/C9H6F2O2/c10-5-3-6(11)9-7(12)1-2-13-8(9)4-5/h3-4H,1-2H2 | | InChIKey | OJVRCPGUGZXUAP-UHFFFAOYSA-N | | SMILES | C1OC2=CC(F)=CC(F)=C2C(=O)C1 |
| | 5,7-difluorochroman-4-one Usage And Synthesis |
| Uses | 5,7-Difluorochroman-4-one is used as a reagent in the prepaation of tetrazolinone compounds,used as pest control agents. |
| | 5,7-difluorochroman-4-one Preparation Products And Raw materials |
|