Company Name: |
GLP Pharma Standards
|
Tel: |
+91 9866074638 |
Email: |
info@glppharmastandards.com |
Products Intro: |
Product Name:Formoterol EP Impurity-B CAS:1224588-66-2 Purity:98% Package:50 MG; 100 MG; 250 MG ; 250 MG
|
ForMoterol-IMpurity-B manufacturers
|
| ForMoterol-IMpurity-B Basic information |
Product Name: | ForMoterol-IMpurity-B | Synonyms: | N-[2-hydroxy-5-[(1RS)-1-hydroxy-2-[[2-(4-methoxyphenyl)ethyl]amino]ethyl]-phenyl]formamide;ForMoterol-IMpurity-B;Formoterol EP Impurity B;Formoterol Impurity 2(Formoterol EP Impurity B);Formoterol impurity 2/Formoterol EP Impurity B/2-Hydroxy-5-[1-hydroxy-2-[[2-(4-methoxyphenyl)ethyl]amino]ethyl]formanilide;Formamide, N-[2-hydroxy-5-[1-hydroxy-2-[[2-(4-methoxyphenyl)ethyl]amino]ethyl]phenyl]-;Formetrol Impurity B;Formoterol Fumarate EP Impurity B | CAS: | 1224588-66-2 | MF: | C18H22N2O4 | MW: | 330.38 | EINECS: | | Product Categories: | | Mol File: | 1224588-66-2.mol | |
| ForMoterol-IMpurity-B Chemical Properties |
Boiling point | 604.2±55.0 °C(Predicted) | density | 1.259±0.06 g/cm3(Predicted) | pka | 9.16±0.50(Predicted) | InChI | InChI=1S/C18H22N2O4/c1-24-15-5-2-13(3-6-15)8-9-19-11-18(23)14-4-7-17(22)16(10-14)20-12-21/h2-7,10,12,18-19,22-23H,8-9,11H2,1H3,(H,20,21) | InChIKey | GLFNPNBHWOMHBI-UHFFFAOYSA-N | SMILES | C(NC1=CC(C(O)CNCCC2=CC=C(OC)C=C2)=CC=C1O)=O |
| ForMoterol-IMpurity-B Usage And Synthesis |
Chemical Properties | IUPAC Name: N-(2-hydroxy-5-(1-hydroxy-2-((4-methoxyphenethyl)amino)ethyl)phenyl)formamide
| Uses | Formoterol EP Impurity B is an impurity of Formoterol (mixture of Diastereomers) (F693395), Formoterol is a selective β2-adrenergic receptor agonist. Formoterol is used as an antiasthmatic. |
| ForMoterol-IMpurity-B Preparation Products And Raw materials |
|