|
|
| | 5-aMino-3-(4-phenoxyphenyl)-1H-pyrazole-4-carbonitrile Basic information |
| Product Name: | 5-aMino-3-(4-phenoxyphenyl)-1H-pyrazole-4-carbonitrile | | Synonyms: | 5-aMino-3-(4-phenoxyphenyl)-1H-pyrazole-4-carbonitrile;3-amino-5-(4-phenoxyphenyl)-1H-Pyrazole-4-carbonitrile;3-AMino-4-cyano-5-(4-phenoxyphenyl)pyrazole;1H-Pyrazole-4-carbonitrile, 3-aMino-5-(4-phenoxyphenyl)-;3-Amino-5-(4-phenoxyphenyl)pyrazole-4-carbonitrile;Ibrutinib intermediates N-3;Zanubrutinib Related Compound 6;Zanubrutinib Impurity 8 | | CAS: | 330792-70-6 | | MF: | C16H12N4O | | MW: | 276.29 | | EINECS: | 805-642-2 | | Product Categories: | 330792-70-6 | | Mol File: | 330792-70-6.mol |  |
| | 5-aMino-3-(4-phenoxyphenyl)-1H-pyrazole-4-carbonitrile Chemical Properties |
| Boiling point | 585.3±50.0 °C(Predicted) | | density | 1.37±0.1 g/cm3(Predicted) | | refractive index | 1.699 | | Fp | 307.8℃ | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | DMSO (Slightly) | | pka | 10.83±0.50(Predicted) | | InChI | InChI=1S/C16H12N4O/c17-10-14-15(19-20-16(14)18)11-6-8-13(9-7-11)21-12-4-2-1-3-5-12/h1-9H,(H3,18,19,20) | | InChIKey | HNIMEQCLCNSCGH-UHFFFAOYSA-N | | SMILES | N1C(C2=CC=C(OC3=CC=CC=C3)C=C2)=C(C#N)C(N)=N1 | | LogP | 3.25298 |
| | 5-aMino-3-(4-phenoxyphenyl)-1H-pyrazole-4-carbonitrile Usage And Synthesis |
| Chemical Properties | Light yellow to off-white powder. | | Uses | 3-Amino-4-cyano-5-(4-phenoxyphenyl)pyrazole has been used as a reactant in the preparation of ring-fused pyrazole derivatives to be used a inhibitors of lymphocyte-specific kinase (Lck) | | Application | 5-amino-3-(4-phenoxyphenyl)-1H-pyrazole-4-carbonitrile is an intermediate of Ibrutinib (PCI-32765). it is a heterocyclic intermediate that typically used in the preparation of ACP-196, a selective second-generation BTK inhibitor. |
| | 5-aMino-3-(4-phenoxyphenyl)-1H-pyrazole-4-carbonitrile Preparation Products And Raw materials |
|