7'-OH-N-trityl Morpholino thyMine manufacturers
|
| | 7'-OH-N-trityl Morpholino thyMine Basic information |
| Product Name: | 7'-OH-N-trityl Morpholino thyMine | | Synonyms: | 7'-OH-N-trityl Morpholino thyMine;1-((2R,6S)-6-(hydroxyMethyl)-4-tritylMorpholin-
2-yl)-5-MethylpyriMidine-2,4-(1H,3H)-dione;1-[(2R,6S)-6-(Hydroxymethyl)-4-(triphenylmethyl)-2-morpholinyl]-5-methyl-2,4(1H,3H)-pyrimidinedione;7'-Hydroxy-N-tritylmorpholino thymine monomer;1-(6-(hydroxymethyl)-4-tritylmorpholin-2-yl)-5-methylpyrimidine-2, 4(1H, 3H)-dione;PMO Thymidine Precusor;PMO-T Precusor;Morpholino-5-Me-U | | CAS: | 914361-76-5 | | MF: | C29H29N3O4 | | MW: | 483.56 | | EINECS: | | | Product Categories: | | | Mol File: | 914361-76-5.mol |  |
| | 7'-OH-N-trityl Morpholino thyMine Chemical Properties |
| density | 1.259±0.06 g/cm3(Predicted) | | pka | 9.51±0.10(Predicted) | | InChIKey | SINOYLIIFJJPCM-IZZNHLLZSA-N | | SMILES | C1(=O)N([C@@H]2O[C@H](CO)CN(C(C3=CC=CC=C3)(C3=CC=CC=C3)C3=CC=CC=C3)C2)C=C(C)C(=O)N1 |
| | 7'-OH-N-trityl Morpholino thyMine Usage And Synthesis |
| Description |
7'-OH-N-trityl Morpholino thyMine (PMO Thymidine Precusor) is a purine nucleoside analog. Purine nucleoside analogs have broad antitumor activity targeting indolent lymphoid malignancies. Anticancer mechanisms in this process rely on inhibiting DNA synthesis, induction of apoptosis, etc.
|
| | 7'-OH-N-trityl Morpholino thyMine Preparation Products And Raw materials |
|