|
|
| | Epinephrine Hydrochloride Basic information |
| Product Name: | Epinephrine Hydrochloride | | Synonyms: | (-)-adrenalinehydrochlorid;l-methylaminoethanolcathecholhydrochloride;nci-c55663;supranephrinsolution;(r)-4-(1-hydroxy-2-(methylamino)ethyl)-1,2-benzenediol hydrochloride;(R)-4-[1-hydroxy-2-(methylamino)ethyl]pyrocatechol hydrochloride;Epinephrine Hydrochloric Acid;EPINEPHRINE HYDROCHLORIC ACID, USP25 98.0+% | | CAS: | 55-31-2 | | MF: | C9H14ClNO3 | | MW: | 219.67 | | EINECS: | 200-230-3 | | Product Categories: | Inhibitors;API;55-31-2 | | Mol File: | 55-31-2.mol |  |
| | Epinephrine Hydrochloride Chemical Properties |
| Melting point | 157°C | | storage temp. | Store at -20°C | | solubility | Soluble in DMSO > 10 mM | | form | Powder | | InChI | InChI=1/C9H13NO3.ClH/c1-10-5-9(13)6-2-3-7(11)8(12)4-6;/h2-4,9-13H,5H2,1H3;1H/t9-;/s3 | | InChIKey | ATADHKWKHYVBTJ-OVMXBOEKNA-N | | SMILES | [C@H](C1C=CC(O)=C(O)C=1)(O)CNC.Cl |&1:0,r| | | CAS DataBase Reference | 55-31-2(CAS DataBase Reference) | | EPA Substance Registry System | Epinephrine hydrochloride (55-31-2) |
| RIDADR | 3249 | | HazardClass | 6.1(a) | | PackingGroup | II |
| | Epinephrine Hydrochloride Usage And Synthesis |
| General Description | Crystals. Used medically as a cardiostimulant. | | Air & Water Reactions | Water soluble [Merck]. | | Reactivity Profile | L-Epinephrine hydrochloride is readily destroyed by alkalis and oxidizing agents . | | Health Hazard | SYMPTOMS: Adverse reactions include restlessness; anxiety; headache; tremor; weakness; dizziness; pallor; respiratory difficulties; palpitation; nausea and vomiting. | | Fire Hazard | Flash point data for L-Epinephrine hydrochloride are not available, but L-Epinephrine hydrochloride is probably combustible. | | Mechanism of action | By stimulating vascular alpha-adrenergic receptors, epinephrine causes vasoconstriction, thereby increasing vascular resistance and blood pressure. When administered in the conjunctiva, Epinephrine Hydrochloride binds to alpha-adrenergic receptors in the iris sphincter muscle, resulting in vasoconstriction, a decrease in the production of aqueous humor, and a lowering of intraocular pressure. Through its beta1 receptor-stimulating actions, epinephrine increases the force and rate of myocardial contraction and relaxes bronchial smooth muscle, resulting in bronchodilation. | | Pharmacology | Epinephrine Hydrochloride is the hydrochloride salt of the naturally occurring sympathomimetic amine with vasoconstricting, intraocular pressure-reducing, and bronchodilating activities. |
| | Epinephrine Hydrochloride Preparation Products And Raw materials |
|