|
|
| | Fosfomycin Trometamol EP Impurity D Basic information |
| Product Name: | Fosfomycin Trometamol EP Impurity D | | Synonyms: | Fosfomycin Trometamol Impurity 4;Fosfomycin Trometamol EP Impurity D;RDPFAWYPVPIZPV-UHFFFAOYSA-N;Fosfomycin Trometamol Impurity 4(Fosfomycin Trometamol EP Impurity D);Phosphonic acid, P-[2-[2-amino-3-hydroxy-2-(hydroxymethyl)propoxy]-1-hydroxypropyl]-, mono(2-hydroxy-1-methyl-2-phosphonoethyl) ester;Trometamoyloxy Fosfomycin-dimer;Fosfomycin?dimer?tromethamine?adduct?(Imp?D);Fosfomycin EP Impurity D | | CAS: | 1262243-12-8 | | MF: | C10H25NO11P2 | | MW: | 397.25 | | EINECS: | | | Product Categories: | | | Mol File: | 1262243-12-8.mol |  |
| | Fosfomycin Trometamol EP Impurity D Chemical Properties |
| Boiling point | 755.0±70.0 °C(Predicted) | | density | 1.638±0.06 g/cm3(Predicted) | | pka | 2.68±0.10(Predicted) | | InChI | InChI=1S/C10H25NO11P2/c1-6(21-5-10(11,3-12)4-13)9(15)24(19,20)22-7(2)8(14)23(16,17)18/h6-9,12-15H,3-5,11H2,1-2H3,(H,19,20)(H2,16,17,18) | | InChIKey | RDPFAWYPVPIZPV-UHFFFAOYSA-N | | SMILES | P(C(O)C(OCC(N)(CO)CO)C)(=O)(O)OC(C)C(O)P(O)(O)=O |
| | Fosfomycin Trometamol EP Impurity D Usage And Synthesis |
| Uses | Trometamoyloxy Fosfomycin-dimer is a Fosfomycin (F727500) impurity. Fosfomycin is an antibiotic that exerts a broad spectrum of antibacterial activity. |
| | Fosfomycin Trometamol EP Impurity D Preparation Products And Raw materials |
|