Fmoc-Ala-Pro-OH manufacturers
- Fmoc-Ala-Pro-OH
-
- $0.00 / 1kg
-
2024-12-25
- CAS:186023-44-9
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T+
- Fmoc-Ala-Pro-OH
-
- $0.00 / 1g
-
2024-03-29
- CAS:186023-44-9
- Min. Order: 1g
- Purity: >95.00%
- Supply Ability: 1g
|
| | Fmoc-Ala-Pro-OH Basic information |
| Product Name: | Fmoc-Ala-Pro-OH | | Synonyms: | (2S)-1-[(2S)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)propanoyl]pyrrolidine-2-carboxylic acid;N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-alanyl-L-proline;L-Proline, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-alanyl-;Fmoc-Ala-Pro-OH (B-4415.0001);(9H-Fluoren-9-yl)MethOxy]Carbonyl Ala-Pro-OH;N-Fmoc-L-Alanyl-L-proline;Fmoc-L-Ala-Pro-OH;FMOC-ALA-PRO-OH | | CAS: | 186023-44-9 | | MF: | C23H24N2O5 | | MW: | 408.45 | | EINECS: | | | Product Categories: | | | Mol File: | 186023-44-9.mol |  |
| | Fmoc-Ala-Pro-OH Chemical Properties |
| Boiling point | 674.0±55.0 °C(Predicted) | | density | 1.318±0.06 g/cm3(Predicted) | | pka | 3.51±0.20(Predicted) | | InChIKey | HLFCRSYTJCARCY-XOBRGWDASA-N | | SMILES | C(O)(=O)[C@@H]1CCCN1C(=O)[C@H](C)NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O |
| | Fmoc-Ala-Pro-OH Usage And Synthesis |
| Description | Fmoc-Ala-Pro-OH is a linker with an Fmoc-protected amine and a terminal carboxylic acid. The Fmoc group can be deprotected under basic condition to obtain the free amine which can be used for further conjugations. The terminal carboxylic acid can be reacted with primary amine groups in the presence of activators (e.g. EDC, or HATU) to form a stable amide bond. |
| | Fmoc-Ala-Pro-OH Preparation Products And Raw materials |
|