|
|
| | CU-CPT-8m Basic information |
| Product Name: | CU-CPT-8m | | Synonyms: | CPD1578;CU-CPT-8m;cas 125079-83-6;CU-CPT-8M;CAS 125079-83-6 ;TLR8 INHIBITOR;TLR8-specific antagonist;7-(m-tolyl)pyrazolo[1,5-a]pyrimidine-3-carboxamide;Pyrazolo[1,5-a]pyrimidine-3-carboxamide, 7-(3-methylphenyl)-;CU CPT 8m,inhibit,Toll-like Receptor (TLR),CUCPT8m,Inhibitor | | CAS: | 125079-83-6 | | MF: | C14H12N4O | | MW: | 252.27 | | EINECS: | | | Product Categories: | | | Mol File: | 125079-83-6.mol |  |
| | CU-CPT-8m Chemical Properties |
| density | 1.35±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform: 5 mg/ml; DMF: 0.2 mg/ml; DMSO: 0.2 mg/ml; Ethanol: slightly soluble | | form | A crystalline solid | | pka | 12.41±0.50(Predicted) | | color | White to off-white | | InChI | InChI=1S/C14H12N4O/c1-9-3-2-4-10(7-9)12-5-6-16-14-11(13(15)19)8-17-18(12)14/h2-8H,1H3,(H2,15,19) | | InChIKey | HNKGGVGQAVODNJ-UHFFFAOYSA-N | | SMILES | C12=C(C(N)=O)C=NN1C(C1=CC=CC(C)=C1)=CC=N2 |
| | CU-CPT-8m Usage And Synthesis |
| | CU-CPT-8m Preparation Products And Raw materials |
|