|
|
| | 1,4-Bis(vinyldimethylsilyl)benzene Basic information |
| Product Name: | 1,4-Bis(vinyldimethylsilyl)benzene | | Synonyms: | 1,4-BIS(VINYLDIMETHYLSILYL)BENZENE;[4-[dimethyl(vinyl)silyl]phenyl]-dimethyl-vinyl-silane;ethenyl-[4-[ethenyl(dimethyl)silyl]phenyl]-dimethylsilane;ethenyl-[4-[ethenyl(dimethyl)silyl]phenyl]-dimethyl-silane;1,4-Bis(dimethyl(vinyl)silyl)benzene;p-Phenylenebis(dimethylvinylsilane);NSC 269580;Benzene, 1,4-bis(ethenyldimethylsilyl)- | | CAS: | 4519-17-9 | | MF: | C14H22Si2 | | MW: | 246.5 | | EINECS: | | | Product Categories: | | | Mol File: | 4519-17-9.mol |  |
| | 1,4-Bis(vinyldimethylsilyl)benzene Chemical Properties |
| Boiling point | 92°C 3mm | | density | 0,912 g/cm3 | | refractive index | 1.512 | | storage temp. | 2-8°C | | form | clear liquid | | Specific Gravity | 0.912 | | color | Colorless to Light yellow | | Hydrolytic Sensitivity | 1: no significant reaction with aqueous systems | | InChI | InChI=1S/C14H22Si2/c1-7-15(3,4)13-9-11-14(12-10-13)16(5,6)8-2/h7-12H,1-2H2,3-6H3 | | InChIKey | VLNRSEGRGSDKLS-UHFFFAOYSA-N | | SMILES | C1([Si](C=C)(C)C)=CC=C([Si](C=C)(C)C)C=C1 |
| TSCA | No | | HS Code | 2931.90.6000 |
| | 1,4-Bis(vinyldimethylsilyl)benzene Usage And Synthesis |
| Description | 1,4-Bis(vinyldimethylsilyl)benzene is a crucial compound utilized in the biomedical industry. This product is commonly employed to synthesize various drugs targeting specific diseases. With its unique chemical structure, it plays a significant role in developing medications for treating diverse ailments, promoting advancements in biomedicine. |
| | 1,4-Bis(vinyldimethylsilyl)benzene Preparation Products And Raw materials |
|