| Company Name: |
Shanghai Jiangshan Biomedical Technology Co., LTD Gold
|
| Tel: |
17821128385 |
| Email: |
871835108@qq.com |
| Products Intro: |
Product Name:2-chloro-4-methanesulfonyl-3-[(2,2,2-trifluoroethoxy)methyl]benzoic acid
CAS:120100-77-8
Purity:99% Package:25kg;200kg;1000kg
|
|
| | 2-chloro-4-methanesulfonyl-3-[(2,2,2-trifluoroethoxy)methyl]benzoic acid Basic information |
| | 2-chloro-4-methanesulfonyl-3-[(2,2,2-trifluoroethoxy)methyl]benzoic acid Chemical Properties |
| Boiling point | 484.8±45.0 °C(Predicted) | | density | 1.522±0.06 g/cm3(Predicted) | | form | solid | | pka | 2.02±0.28(Predicted) | | color | White | | InChI | InChI=1S/C11H10ClF3O5S/c1-21(18,19)8-3-2-6(10(16)17)9(12)7(8)4-20-5-11(13,14)15/h2-3H,4-5H2,1H3,(H,16,17) | | InChIKey | YGMJOCQCLVNPOD-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=C(S(C)(=O)=O)C(COCC(F)(F)F)=C1Cl | | EPA Substance Registry System | Benzoic acid, 2-chloro-4-(methylsulfonyl)-3-[(2,2,2-trifluoroethoxy)methyl]- (120100-77-8) |
| | 2-chloro-4-methanesulfonyl-3-[(2,2,2-trifluoroethoxy)methyl]benzoic acid Usage And Synthesis |
| Description | 2-chloro-4-methanesulfonyl-3-[(2,2,2-trifluoroethoxy)methyl]benzoic acid is a herbicide used primarily in corn fields. | | Chemical Properties | Appearance: White solid | | Uses | 2-chloro-4-methanesulfonyl-3-[(2,2,2-trifluoroethoxy)methyl]benzoic acid is an intermediate for the production of the pesticide tembotrione. tembotrione is a triketone group herbicide having worldwide applications for weed management in maize.
? |
| | 2-chloro-4-methanesulfonyl-3-[(2,2,2-trifluoroethoxy)methyl]benzoic acid Preparation Products And Raw materials |
|