| Company Name: |
TargetMol Chemicals Inc.
|
| Tel: |
15002134094 |
| Email: |
marketing@targetmol.cn |
| Products Intro: |
Product Name:Piprozolin；W3699|||W-3699|||W 3699
CAS:17243-64-0
Purity:99.62% Package:详见官网
|
|
| | piprozolin Basic information |
| Product Name: | piprozolin | | Synonyms: | 3-Ethyl-4-oxo-5-piperidinothiazolidin-2-ylideneacetic acid ethyl ester;Go 919;Go-919;W 3699;W-3699;Acetic acid, [3-ethyl-4-oxo-5-(1-piperidinyl)-2-thiazolidinylidene]-, ethyl ester;Ethyl (3-ethyl-4-oxo-5-piperidin-1-yl-1,3-thiazolidin-2-ylidene)acetate;Inchi=1/C14H22N2o3S/C1-3-16-11(10-12(17)19-4-2)20-14(13(16)18)15-8-6-5-7-9-15/H10,14H,3-9H2,1-2h | | CAS: | 17243-64-0 | | MF: | C14H22N2O3S | | MW: | 298.4 | | EINECS: | 2412806 | | Product Categories: | | | Mol File: | 17243-64-0.mol |  |
| | piprozolin Chemical Properties |
| Melting point | 86-87° | | Boiling point | 460.2±45.0 °C(Predicted) | | density | 1.252±0.06 g/cm3(Predicted) | | pka | 4.15±0.20(Predicted) |
| Toxicity | LD50 in mice, rats (mg/kg): 1070, 3256 orally (Herrmann) |
| | piprozolin Usage And Synthesis |
| Originator | Probilin ,Goedecke ,W. Germany ,1977 | | Uses | Choleretic. | | Manufacturing Process | Ethyl thioglycolate and ethyl cyanoacetate are first reacted in the presence of sodium ethylate to give 4-oxo-thiazolidin-2-ylideneacetic acid ethyl ester. That is reacted with diethyl sulfate and then with piperidine to give piprozolin. | | Brand name | Probkin (Parke-Davis). | | Therapeutic Function | Choleretic |
| | piprozolin Preparation Products And Raw materials |
|