|
|
| | 2,3-DIFLUORO-5-NITROPYRIDINE Basic information |
| | 2,3-DIFLUORO-5-NITROPYRIDINE Chemical Properties |
| Boiling point | 226.2±35.0 °C(Predicted) | | density | 1.555±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | -6.89±0.20(Predicted) | | form | liquid | | color | Colourless to light yellow | | InChI | InChI=1S/C5H2F2N2O2/c6-4-1-3(9(10)11)2-8-5(4)7/h1-2H | | InChIKey | YJBQJGQRNAZQPG-UHFFFAOYSA-N | | SMILES | C1(F)=NC=C([N+]([O-])=O)C=C1F |
| | 2,3-DIFLUORO-5-NITROPYRIDINE Usage And Synthesis |
| Uses | 2,3-Difluoro-5-nitropyridine is a useful reagent in preparation of nucleophilic aromatic substitution of aryl and heteroaryl halides with nitrogen and oxygen nucleophiles via micellar catalysis. |
| | 2,3-DIFLUORO-5-NITROPYRIDINE Preparation Products And Raw materials |
|