9-(4-tert-Butylphenyl)-3,6-bis(triphenylsilyl)-9H-carbazole manufacturers
- CzSi
-
- $0.00 / 1g
-
2024-11-27
- CAS:898546-82-2
- Min. Order: 1g
- Purity: 99%
- Supply Ability: 100KGS
|
| | 9-(4-tert-Butylphenyl)-3,6-bis(triphenylsilyl)-9H-carbazole Basic information |
| Product Name: | 9-(4-tert-Butylphenyl)-3,6-bis(triphenylsilyl)-9H-carbazole | | Synonyms: | CzSi , 9-(4-tert-butylphenyl)-3,6-bis(triphenylsilyl)-9H-carba;CZSI;9-(4-tert-Butylphenyl)-3,6-bis(triphenylsilyl)-9H-carbazole;[9-(4-tert-butylphenyl)-6-triphenylsilylcarbazol-3-yl]-triphenylsilane;9H-Carbazole, 9-[4-(1,1-dimethylethyl)phenyl]-3,6-bis(triphenylsilyl)-;9-(4-tert-Butylphenyl)-3,6-bis(triphenylsilyl)-9H-carbazole ISO 9001：2015 REACH | | CAS: | 898546-82-2 | | MF: | C58H49NSi2 | | MW: | 816.19 | | EINECS: | | | Product Categories: | | | Mol File: | 898546-82-2.mol |  |
| | 9-(4-tert-Butylphenyl)-3,6-bis(triphenylsilyl)-9H-carbazole Chemical Properties |
| Melting point | 354 °C(Solv: chloroform (67-66-3); hexane (110-54-3)) | | density | 1.05 | | form | powder/crystals | | color | Off-white | | InChIKey | WIHKEPSYODOQJR-UHFFFAOYSA-N | | SMILES | N1(C2=CC=C(C(C)(C)C)C=C2)C2=C(C=C([Si](C3=CC=CC=C3)(C3=CC=CC=C3)C3=CC=CC=C3)C=C2)C2=C1C=CC([Si](C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1)=C2 | | Fluorescene | λem?354 nm in CH2Cl2 | | Absorption | λmax?275 nm in?CH2Cl2 |
| | 9-(4-tert-Butylphenyl)-3,6-bis(triphenylsilyl)-9H-carbazole Usage And Synthesis |
| Description | CzSi is known for its high triplet energy, wide band-gap, and high glass-transition temperature (Tg >131 °C). It is one of the most widely-used TADF host materials for blue electrophosphorescence. | | Uses | Carbazole-based host materials for blue electrophosphorescence. |
| | 9-(4-tert-Butylphenyl)-3,6-bis(triphenylsilyl)-9H-carbazole Preparation Products And Raw materials |
|