|
| ethyl 4,6-dihydroxypyridazine-3-carboxylate Basic information |
Product Name: | ethyl 4,6-dihydroxypyridazine-3-carboxylate | Synonyms: | ethyl 4,6-dihydroxypyridazine-3-carboxylate;3-Pyridazinecarboxylic acid, 1,6-dihydro-4-hydroxy-6-oxo-, ethyl ester;4,6-dihydroxy-pyridazine-3-carboxylic acid ethyl ester;EOS-61509;ethyl 4-hydroxy-6-oxo-1H-pyridazine-3-carboxylate;Ethyl 4-hydroxy-6-oxo-1,6-dihydropyridazine-3-carboxylate | CAS: | 1352925-63-3 | MF: | C7H8N2O4 | MW: | 184.15 | EINECS: | | Product Categories: | | Mol File: | 1352925-63-3.mol | ![ethyl 4,6-dihydroxypyridazine-3-carboxylate Structure](CAS/GIF/1352925-63-3.gif) |
| ethyl 4,6-dihydroxypyridazine-3-carboxylate Chemical Properties |
density | 1.48±0.1 g/cm3(Predicted) | storage temp. | 2-8°C | pka | 4.50±1.00(Predicted) | InChI | InChI=1S/C7H8N2O4/c1-2-13-7(12)6-4(10)3-5(11)8-9-6/h3H,2H2,1H3,(H2,8,10,11) | InChIKey | QHSUCVJSGHLDIA-UHFFFAOYSA-N | SMILES | C1(C(OCC)=O)=NNC(=O)C=C1O |
| ethyl 4,6-dihydroxypyridazine-3-carboxylate Usage And Synthesis |
Uses |
Ethyl 4,6-dihydroxypyridazine-3-carboxylate is a valuable compound that could synthesize ethyl 4,6-dichloropyrridazine-3-carboxylate.
|
| ethyl 4,6-dihydroxypyridazine-3-carboxylate Preparation Products And Raw materials |
|