|
|
| | 2'-O-Propygylguanosine Basic information |
| | 2'-O-Propygylguanosine Chemical Properties |
| density | 1.76±0.1 g/cm3(Predicted) | | pka | 9?+-.0.20(Predicted) | | InChI | InChI=1S/C13H15N5O5/c1-2-3-22-9-8(20)6(4-19)23-12(9)18-5-15-7-10(18)16-13(14)17-11(7)21/h1,5-6,8-9,12,19-20H,3-4H2,(H3,14,16,17,21)/t6-,8-,9-,12-/m1/s1 | | InChIKey | VBIXIAQUDWOPDT-WOUKDFQISA-N | | SMILES | OC[C@H]1O[C@@H](N2C3=C(C(NC(=N3)N)=O)N=C2)[C@H](OCC#C)[C@@H]1O |
| | 2'-O-Propygylguanosine Usage And Synthesis |
| Description |
2′-O-2-Propyn-1-ylguanosine (2'-O-Propygylguanosine) is a guanosine analogue. Some guanosine analogs have immunostimulatory activity. In some animal models, they also induce type I interferons, producing antiviral effects. Studies have shown that the functional activity of guanosine analogs is dependent on the activation of Toll-like receptor 7 (TLR7). 2′-O-2-Propyn-1-ylguanosine is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups.
| | Solubility in organics |
10 mM in DMSO
|
| | 2'-O-Propygylguanosine Preparation Products And Raw materials |
|